The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(3-(2-((4-(4-methylpiperazin-1-yl)phenyl)amino)-8-(phenylamino)-9H-purin-9-yl)pyrrolidin-1-yl)prop-2-en-1-one ID: ALA5202214
PubChem CID: 162356161
Max Phase: Preclinical
Molecular Formula: C29H33N9O
Molecular Weight: 523.65
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CC[C@H](n2c(Nc3ccccc3)nc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)C1
Standard InChI: InChI=1S/C29H33N9O/c1-3-26(39)37-14-13-24(20-37)38-27-25(33-29(38)32-21-7-5-4-6-8-21)19-30-28(34-27)31-22-9-11-23(12-10-22)36-17-15-35(2)16-18-36/h3-12,19,24H,1,13-18,20H2,2H3,(H,32,33)(H,30,31,34)/t24-/m0/s1
Standard InChI Key: RGGHJDGRJJWIJE-DEOSSOPVSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-3.3746 0.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3757 -0.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6624 -1.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9474 -0.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9503 0.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6642 0.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6667 1.3908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9548 1.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2427 1.3926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2527 3.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9610 2.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6626 -1.8986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3716 -2.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3718 -3.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6630 -3.5356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6632 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9540 -3.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9539 -2.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5334 2.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5291 1.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2547 1.5537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7350 2.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2478 2.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5535 2.2263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5117 0.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0386 0.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5231 -0.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3003 -0.2914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2959 0.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9591 2.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9650 -0.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8837 -1.5835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7110 -0.4322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3757 -0.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7778 2.9363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1833 3.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7703 4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9476 4.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5458 3.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
10 11 2 0
11 8 1 0
3 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
12 18 1 0
17 18 1 0
19 10 1 0
9 20 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 19 1 0
22 24 1 0
25 21 1 6
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
24 30 1 0
28 31 1 0
31 32 2 0
31 33 1 0
33 34 2 0
30 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.65Molecular Weight (Monoisotopic): 523.2808AlogP: 4.02#Rotatable Bonds: 7Polar Surface Area: 94.45Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.96CX LogP: 4.08CX LogD: 3.41Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -1.18
References 1. Zhao HY, Wang HP, Mao YZ, Zhang H, Xin M, Xi XX, Lei H, Mao S, Li DH, Zhang SQ.. (2022) Discovery of Potent PROTACs Targeting EGFR Mutants through the Optimization of Covalent EGFR Ligands., 65 (6.0): [PMID:35254067 ] [10.1021/acs.jmedchem.1c01827 ]