2-methyl-N-(pyridin-2-ylmethyl)-5-(4-(4-sulfamoylphenylamino)phthalazin-1-yl)benzenesulfonamide

ID: ALA5202320

PubChem CID: 5292293

Max Phase: Preclinical

Molecular Formula: C27H24N6O4S2

Molecular Weight: 560.66

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2nnc(Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)cc1S(=O)(=O)NCc1ccccn1

Standard InChI:  InChI=1S/C27H24N6O4S2/c1-18-9-10-19(16-25(18)39(36,37)30-17-21-6-4-5-15-29-21)26-23-7-2-3-8-24(23)27(33-32-26)31-20-11-13-22(14-12-20)38(28,34)35/h2-16,30H,17H2,1H3,(H,31,33)(H2,28,34,35)

Standard InChI Key:  MWYBWYBJIFJRII-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    0.2401    3.1878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6520    2.4730    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0647    3.1878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3655    2.0611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0790    2.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0613    2.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0613    1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7731    0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4857    1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4857    2.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7720    2.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7720    3.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7731    0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4846   -0.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4846   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7680   -1.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7680   -2.4711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0545   -2.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0545   -3.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6608   -4.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -3.7066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0834   -4.1185    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4962   -3.4055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9088   -4.1185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0834   -4.9424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -2.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6590   -2.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0575   -1.2312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0575   -0.4115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1935   -1.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9088   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9088   -0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1953    0.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0790    3.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3656    3.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3664    4.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0801    4.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7908    4.5339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7955    3.7105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  6  2  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
 11 12  1  0
 13  8  1  0
 14 13  1  0
 15 14  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  2  0
 22 25  1  0
 21 26  2  0
 26 27  1  0
 27 18  2  0
 16 28  2  0
 28 29  1  0
 29 13  2  0
 30 15  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 14 33  1  0
  5 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 34 39  1  0
M  END

Associated Targets(Human)

ENPP3 Tchem Ectonucleotide pyrophosphatase/phosphodiesterase family member 3 (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 560.66Molecular Weight (Monoisotopic): 560.1300AlogP: 3.87#Rotatable Bonds: 8
Polar Surface Area: 157.03Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.07CX Basic pKa: 4.15CX LogP: 3.37CX LogD: 3.37
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.87

References

1. Lee SY, Namasivayam V, Boshta NM, Perotti A, Mirza S, Bua S, Supuran CT, Müller CE..  (2021)  Discovery of potent nucleotide pyrophosphatase/phosphodiesterase3 (NPP3) inhibitors with ancillary carbonic anhydrase inhibition for cancer (immuno)therapy.,  12  (7.0): [PMID:34355184] [10.1039/D1MD00117E]
2. Ahmad, Haseen and 7 more authors.  2020-12-15  Synthesis of biphenyl oxazole derivatives via Suzuki coupling and biological evaluations as nucleotide pyrophosphatase/phosphodiesterase-1 and -3 inhibitors.  [PMID:32883636]

Source