The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl ((E)-3-(4-(trifluoromethyl)phenyl)acryloyl)glycyl-L-valyl-D-glutamate ID: ALA5202454
PubChem CID: 168292588
Max Phase: Preclinical
Molecular Formula: C26H34F3N3O7
Molecular Weight: 557.57
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(C(F)(F)F)cc1)C(C)C)C(=O)OCC
Standard InChI: InChI=1S/C26H34F3N3O7/c1-5-38-22(35)14-12-19(25(37)39-6-2)31-24(36)23(16(3)4)32-21(34)15-30-20(33)13-9-17-7-10-18(11-8-17)26(27,28)29/h7-11,13,16,19,23H,5-6,12,14-15H2,1-4H3,(H,30,33)(H,31,36)(H,32,34)/b13-9+/t19-,23+/m1/s1
Standard InChI Key: IGTBNUZNLABPCZ-WKZIBFJNSA-N
Molfile:
RDKit 2D
39 39 0 0 0 0 0 0 0 0999 V2000
-2.5219 0.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8074 0.4487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5219 -0.7890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2366 0.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9513 0.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6661 0.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3809 0.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0931 0.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0931 1.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3827 1.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6661 1.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8078 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0927 0.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3780 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3366 0.0361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3780 1.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0513 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7660 0.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0513 1.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4807 0.4487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7660 -0.7891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1954 0.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6248 0.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3395 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 0.0361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7689 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1954 -0.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 -1.2018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4807 -1.2018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 -2.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2428 -2.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5224 0.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3395 1.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7660 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3366 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5224 1.2740 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.8078 2.5118 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.5224 2.0992 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 2 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
9 12 1 0
2 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
17 19 1 1
18 20 1 0
18 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
22 28 1 6
28 29 1 0
28 30 2 0
29 31 1 0
32 31 1 0
33 27 1 0
25 34 2 0
35 19 1 0
19 36 1 0
12 37 1 0
12 38 1 0
12 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.57Molecular Weight (Monoisotopic): 557.2349AlogP: 2.37#Rotatable Bonds: 14Polar Surface Area: 139.90Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.88CX Basic pKa: ┄CX LogP: 2.38CX LogD: 2.38Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -0.53