The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-(6-((4-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-5-fluoropyrimidin-2-yl)amino)pyridin-3-yl)piperazine-1-carboxylate ID: ALA5202493
PubChem CID: 168292504
Max Phase: Preclinical
Molecular Formula: C26H29FN6O4
Molecular Weight: 508.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3ncc(F)c(-c4ccc5c(c4)OCCO5)n3)nc2)CC1
Standard InChI: InChI=1S/C26H29FN6O4/c1-26(2,3)37-25(34)33-10-8-32(9-11-33)18-5-7-22(28-15-18)30-24-29-16-19(27)23(31-24)17-4-6-20-21(14-17)36-13-12-35-20/h4-7,14-16H,8-13H2,1-3H3,(H,28,29,30,31)
Standard InChI Key: ZGPWKARBGLEAAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-1.4210 -0.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4210 -0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7094 0.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0005 -0.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0005 -0.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7076 -1.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7110 -1.2333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4226 -0.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4229 -0.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1327 0.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8445 -0.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5561 0.4079 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8461 -0.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1373 -1.2352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5577 -1.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2695 -0.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9785 -1.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6904 -0.8199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4022 -1.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4022 -2.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6904 -2.4638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9785 -2.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2713 -2.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5577 -2.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1326 0.4094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8442 -0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5558 0.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5558 1.2313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8442 1.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1326 1.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2674 1.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9790 1.2313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2674 2.4638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6906 1.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4022 1.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6906 2.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4022 2.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
11 12 1 0
13 11 1 0
14 13 2 0
8 14 1 0
13 15 1 0
16 15 2 0
17 16 1 0
17 18 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
22 17 2 0
23 22 1 0
24 23 2 0
15 24 1 0
25 2 1 0
25 26 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
25 30 1 0
28 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.55Molecular Weight (Monoisotopic): 508.2234AlogP: 4.25#Rotatable Bonds: 4Polar Surface Area: 101.94Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.82CX Basic pKa: 3.67CX LogP: 4.09CX LogD: 4.09Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.55Np Likeness Score: -1.44
References 1. Chen W, Ji M, Cheng H, Zheng M, Xia F, Min W, Yang H, Wang X, Wang L, Cao L, Yuan K, Yang P.. (2022) Discovery, Optimization, and Evaluation of Selective CDK4/6 Inhibitors for the Treatment of Breast Cancer., 65 (22.0): [PMID:36350721 ] [10.1021/acs.jmedchem.2c00947 ]