(2S)-N-[(1S)-2-(3-Methyl-1,2,4-oxadiazol-5-yl)-1-{4-[(2-methylpentyl)oxy]phenyl}ethyl]-2-phenylpropanamide

ID: ALA5202571

PubChem CID: 168292704

Max Phase: Preclinical

Molecular Formula: C26H33N3O3

Molecular Weight: 435.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)COc1ccc([C@H](Cc2nc(C)no2)NC(=O)[C@@H](C)c2ccccc2)cc1

Standard InChI:  InChI=1S/C26H33N3O3/c1-5-9-18(2)17-31-23-14-12-22(13-15-23)24(16-25-27-20(4)29-32-25)28-26(30)19(3)21-10-7-6-8-11-21/h6-8,10-15,18-19,24H,5,9,16-17H2,1-4H3,(H,28,30)/t18?,19-,24-/m0/s1

Standard InChI Key:  FIYQTETWNXSHTR-GRZKKUKKSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   33.1650   -4.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1638   -4.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8719   -5.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5816   -4.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5787   -4.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8701   -3.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2849   -3.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9941   -4.0151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7003   -3.6038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4095   -4.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6972   -2.7866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4126   -4.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1157   -3.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8210   -4.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5266   -3.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5240   -2.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8098   -2.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1070   -2.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4558   -5.2516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2818   -2.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5726   -2.3860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4839   -1.5769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6839   -1.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2780   -2.1193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8271   -2.7245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7484   -4.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0404   -5.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3330   -4.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6250   -5.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9176   -4.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0398   -6.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3487   -0.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  6
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 19  1  0
  7 20  1  6
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 27 31  1  0
 23 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5202571

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.57Molecular Weight (Monoisotopic): 435.2522AlogP: 5.40#Rotatable Bonds: 11
Polar Surface Area: 77.25Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.24CX Basic pKa: CX LogP: 5.67CX LogD: 5.67
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.01

References

1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C..  (2021)  Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies.,  64  (16.0): [PMID:34387471] [10.1021/acs.jmedchem.1c01075]

Source