The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(2R)-1-[[4-[[3-methyl-5-[(4-nitrophenyl)sulfonylmethyl]phenoxy]methyl]phenyl]methyl]pyrrolidin-2-yl]methanol ID: ALA5202631
PubChem CID: 168293292
Max Phase: Preclinical
Molecular Formula: C27H30N2O6S
Molecular Weight: 510.61
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(CS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc(OCc2ccc(CN3CCC[C@@H]3CO)cc2)c1
Standard InChI: InChI=1S/C27H30N2O6S/c1-20-13-23(19-36(33,34)27-10-8-24(9-11-27)29(31)32)15-26(14-20)35-18-22-6-4-21(5-7-22)16-28-12-2-3-25(28)17-30/h4-11,13-15,25,30H,2-3,12,16-19H2,1H3/t25-/m1/s1
Standard InChI Key: OEOMRGLCJZQANT-RUZDIDTESA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-1.3654 1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6508 1.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0610 1.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0610 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6490 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3654 0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0800 -0.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7947 0.2037 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5093 -0.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5095 -1.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2224 -1.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9372 -1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9389 -0.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2270 0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7947 1.0289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5093 0.6164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6508 2.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7757 -0.2051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4902 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2049 -0.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9197 0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6318 -0.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6318 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9215 -1.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2049 -1.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3464 -1.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0611 -1.0301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8145 -1.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3665 -0.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9541 -0.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1473 -0.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5638 0.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7774 1.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6519 -1.4446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.3665 -1.0320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6519 -2.2697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
7 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
8 15 2 0
8 16 2 0
2 17 1 0
4 18 1 0
18 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
23 26 1 0
26 27 1 0
28 27 1 0
29 28 1 0
30 29 1 0
30 31 1 0
31 27 1 0
31 32 1 1
32 33 1 0
34 12 1 0
34 35 1 0
34 36 2 0
M CHG 2 34 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.61Molecular Weight (Monoisotopic): 510.1825AlogP: 4.41#Rotatable Bonds: 10Polar Surface Area: 109.98Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.09CX LogP: 4.43CX LogD: 2.74Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -1.28
References 1. Zhang S, Chen X, Wu C, Xu H, Xie X, Feng M, Hu S, Bai H, Gao F, Tong L, Ding J, Liu H, Xie Z, Wang J.. (2022) Novel Sphingosine Kinase 1 Inhibitor Suppresses Growth of Solid Tumor and Inhibits the Lung Metastasis of Triple-Negative Breast Cancer., 65 (11.0): [PMID:35439002 ] [10.1021/acs.jmedchem.2c00040 ]