The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-(4-(3-(3-(2-methoxyphenyl)-4-oxothiazolidin-2-yl)benzamido)butyl)piperazine-1-carboxylate ID: ALA5202696
PubChem CID: 168293842
Max Phase: Preclinical
Molecular Formula: C30H40N4O5S
Molecular Weight: 568.74
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCCN2CCN(C(=O)OC(C)(C)C)CC2)c1
Standard InChI: InChI=1S/C30H40N4O5S/c1-30(2,3)39-29(37)33-18-16-32(17-19-33)15-8-7-14-31-27(36)22-10-9-11-23(20-22)28-34(26(35)21-40-28)24-12-5-6-13-25(24)38-4/h5-6,9-13,20,28H,7-8,14-19,21H2,1-4H3,(H,31,36)
Standard InChI Key: IXORKMLBOZTXSC-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-2.1393 -2.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3131 -1.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1029 -0.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7183 -1.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5458 -2.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7499 -2.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6985 -0.6827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8903 -0.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5488 -1.6118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4750 -0.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0310 0.4814 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 0.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5050 0.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5050 1.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2272 1.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2272 2.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9493 3.0404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5158 3.0423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7972 2.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0781 3.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3595 2.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3553 3.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0781 2.6408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0781 1.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7965 1.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5128 1.8169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5128 2.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7916 3.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2311 1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9493 1.8169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2311 0.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5128 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5128 -0.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7946 0.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7946 -0.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9444 1.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9444 0.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2246 0.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3383 -2.2598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1237 -3.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
6 1 2 0
5 6 1 0
7 2 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
13 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
23 28 1 0
26 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
15 36 1 0
36 37 2 0
38 13 2 0
37 38 1 0
1 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.74Molecular Weight (Monoisotopic): 568.2719AlogP: 4.54#Rotatable Bonds: 9Polar Surface Area: 91.42Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.23CX LogP: 3.44CX LogD: 3.22Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.44Np Likeness Score: -1.30
References 1. Deng Y, Pi R, Niu L, Zhao Y, Ni D, Song L, Li Z, Han W, Wei Q, Han Y, Zhu T, Luo Z, Sun D, Dong S, Liu S.. (2022) Novel 2-phenyl-3-(Pyridin-2-yl) thiazolidin-4-one derivatives as potent inhibitors for proliferation of osteosarcoma cells in vitro and in vivo., 228 [PMID:34861640 ] [10.1016/j.ejmech.2021.114010 ]