The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-N-(2-(1-benzyl-1H-1,2,3-triazol-4-yl)ethyl)-4-(phenylsulfamoyl)benzamide ID: ALA5202731
PubChem CID: 168292807
Max Phase: Preclinical
Molecular Formula: C31H29N5O3S
Molecular Weight: 551.67
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(S(=O)(=O)Nc2ccccc2)cc1)N(CCc1cn(Cc2ccccc2)nn1)Cc1ccccc1
Standard InChI: InChI=1S/C31H29N5O3S/c37-31(27-16-18-30(19-17-27)40(38,39)33-28-14-8-3-9-15-28)35(22-25-10-4-1-5-11-25)21-20-29-24-36(34-32-29)23-26-12-6-2-7-13-26/h1-19,24,33H,20-23H2
Standard InChI Key: MHHANVFFZKSSTL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-3.0078 -0.1355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2933 0.2769 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8801 0.9927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7050 0.9927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5788 -0.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8642 0.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1524 -0.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1524 -0.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8625 -1.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5788 -0.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5620 -1.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2764 -0.9603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9908 -1.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9908 -2.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7052 -2.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7044 -3.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9898 -3.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2781 -3.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2734 -2.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2764 -0.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5620 -2.1977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7221 0.2769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7221 1.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4339 1.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1483 1.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1483 0.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4321 -0.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9908 0.2771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9908 1.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2764 1.5145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4617 2.3358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2630 2.4166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 1.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6755 3.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5004 3.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9132 3.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7357 3.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1483 3.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7391 2.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9147 2.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
6 5 2 0
7 6 1 0
8 7 2 0
9 8 1 0
10 9 2 0
5 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
12 20 1 0
11 21 2 0
22 1 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
28 29 1 0
30 29 1 0
30 31 2 0
31 32 1 0
33 32 1 0
29 33 2 0
32 34 1 0
34 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
40 39 2 0
35 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.67Molecular Weight (Monoisotopic): 551.1991AlogP: 5.01#Rotatable Bonds: 11Polar Surface Area: 97.19Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.63CX Basic pKa: 0.31CX LogP: 5.30CX LogD: 5.12Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.86
References 1. Hanke T, Mathea S, Woortman J, Salah E, Berger BT, Tumber A, Kashima R, Hata A, Kuster B, Müller S, Knapp S.. (2022) Development and Characterization of Type I, Type II, and Type III LIM-Kinase Chemical Probes., 65 (19.0): [PMID:36136092 ] [10.1021/acs.jmedchem.2c01106 ]