3-[15-(3-hydroxy-2-iodo-phenyl)-21,23-dihydroporphyrin-5-yl]-2-iodo-phenol

ID: ALA5202776

PubChem CID: 168293064

Max Phase: Preclinical

Molecular Formula: C32H20I2N4O2

Molecular Weight: 746.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(O)c4I)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1I

Standard InChI:  InChI=1S/C32H20I2N4O2/c33-31-21(3-1-5-27(31)39)29-23-11-7-17(35-23)15-19-9-13-25(37-19)30(22-4-2-6-28(40)32(22)34)26-14-10-20(38-26)16-18-8-12-24(29)36-18/h1-16,35,38-40H/b17-15-,18-16-,19-15-,20-16-,29-23-,29-24-,30-25-,30-26-

Standard InChI Key:  XJURBSZGINTDKF-LKZIIFATSA-N

Molfile:  

 
     RDKit          2D

 40 46  0  0  0  0  0  0  0  0999 V2000
   -4.6790   -0.1898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0822    0.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2956    0.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7260    0.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9430    1.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7296    1.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2992    1.1663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9393    0.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7766   -0.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0442   -0.5967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1256   -1.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5018   -1.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2848   -1.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6102   -1.0307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4240   -1.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9665   -0.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7531   -0.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9701   -1.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7567   -1.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3263   -1.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1093   -0.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6790    0.2170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3228   -0.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1115    0.6528    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    1.8037    0.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0442    0.6238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1528    1.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5289    1.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2576    1.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8544    2.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5596    1.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3969    1.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5831    1.0578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9393    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3463    0.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5867   -1.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8815   -2.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9122   -1.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3191   -0.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0843   -0.6256    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  7  6  1  0
  2  7  2  0
  4  8  1  0
  9  8  2  0
  9 10  1  0
 11 10  2  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 16 17  1  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 21 22  1  0
 23 21  1  0
 17 23  2  0
 23 24  1  0
 25 16  1  0
 25 26  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 29 30  2  0
 30 31  1  0
 32 31  2  0
  8 32  1  0
 32 33  1  0
 33 29  1  0
 27 34  1  0
 34 35  2  0
 35 25  1  0
 15 36  1  0
 36 37  2  0
 37 13  1  0
 38 11  1  0
 39 38  2  0
 39  9  1  0
  3 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5202776

    ---

Associated Targets(Human)

WiDr (1835 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 746.35Molecular Weight (Monoisotopic): 745.9676AlogP: 8.61#Rotatable Bonds: 2
Polar Surface Area: 97.82Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.83CX Basic pKa: 5.09CX LogP: 9.18CX LogD: 9.03
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.13Np Likeness Score: 0.15

References

1. Janas K, Boniewska-Bernacka E, Dyrda G, Słota R..  (2021)  Porphyrin and phthalocyanine photosensitizers designed for targeted photodynamic therapy of colorectal cancer.,  30  [PMID:33341498] [10.1016/j.bmc.2020.115926]

Source