N-(3-((5-iodo-2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)butyramide

ID: ALA5202966

PubChem CID: 168292735

Max Phase: Preclinical

Molecular Formula: C26H31IN6O3

Molecular Weight: 602.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ncc2I)c1

Standard InChI:  InChI=1S/C26H31IN6O3/c1-4-6-24(34)29-18-7-5-8-20(15-18)36-25-21(27)17-28-26(31-25)30-22-10-9-19(16-23(22)35-3)33-13-11-32(2)12-14-33/h5,7-10,15-17H,4,6,11-14H2,1-3H3,(H,29,34)(H,28,30,31)

Standard InChI Key:  BPYKQTHTQTXEMN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -3.9113    0.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9113   -0.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1980   -0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4909   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4909    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1997    1.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1997    1.8482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9114    2.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9114    3.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6230    3.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6230    4.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6230    1.8482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7792   -0.6161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7792   -1.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685   -1.8489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685   -2.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7803   -3.0791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4939   -2.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4939   -1.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2056   -1.4396    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3569   -3.0789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3547   -2.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3547   -1.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0647   -1.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7765   -1.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7765   -2.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0693   -3.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0693   -3.9024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7809   -4.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4882   -1.4375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4882   -0.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1997   -0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9114   -0.6158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9114   -1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1998   -1.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6230   -0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  8 12  2  0
  4 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 19 20  1  0
 16 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 30 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5202966

    ---

Associated Targets(Human)

NUAK2 Tchem NUAK family SNF1-like kinase 2 (630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 602.48Molecular Weight (Monoisotopic): 602.1502AlogP: 5.12#Rotatable Bonds: 9
Polar Surface Area: 91.85Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.37CX Basic pKa: 7.84CX LogP: 5.37CX LogD: 4.79
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.66

References

1. Faisal M, Kim JH, Yoo KH, Roh EJ, Hong SS, Lee SH..  (2021)  Development and Therapeutic Potential of NUAKs Inhibitors.,  64  (1.0): [PMID:33356242] [10.1021/acs.jmedchem.0c00533]

Source