5-(4-fluorophenyl)penta-2,4-dienehydrazide

ID: ALA5202999

PubChem CID: 168292743

Max Phase: Preclinical

Molecular Formula: C11H11FN2O

Molecular Weight: 206.22

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NNC(=O)/C=C/C=C/c1ccc(F)cc1

Standard InChI:  InChI=1S/C11H11FN2O/c12-10-7-5-9(6-8-10)3-1-2-4-11(15)14-13/h1-8H,13H2,(H,14,15)/b3-1+,4-2+

Standard InChI Key:  AJCMMDTZQGZMQK-ZPUQHVIOSA-N

Molfile:  

 
     RDKit          2D

 15 15  0  0  0  0  0  0  0  0999 V2000
    3.5716    0.4115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571   -0.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427    1.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282   -0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7137    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7151    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1469    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1425   -1.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5716   -1.2364    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  2  0
  5  3  1  0
  6  5  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  9  2  0
 12 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5202999

    ---

Associated Targets(non-human)

Mycobacteroides abscessus (2066 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium marinum (465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 206.22Molecular Weight (Monoisotopic): 206.0855AlogP: 1.39#Rotatable Bonds: 3
Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.49CX Basic pKa: 3.29CX LogP: 1.70CX LogD: 1.70
Aromatic Rings: 1Heavy Atoms: 15QED Weighted: 0.26Np Likeness Score: -0.44

References

1. Mavrikaki V, Pagonis A, Poncin I, Mallick I, Canaan S, Magrioti V, Cavalier JF..  (2022)  Design, synthesis and antibacterial activity against pathogenic mycobacteria of conjugated hydroxamic acids, hydrazides and O-alkyl/O-acyl protected hydroxamic derivatives.,  64  [PMID:35307568] [10.1016/j.bmcl.2022.128692]

Source