The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-N-[(1R)-2-(4-tert-Butyl-1H-1,2,3-triazol-1-yl)-1-[4-(cyclobutylmethoxy)phenyl]ethyl]-2-phenylpropanamide ID: ALA5203098
PubChem CID: 168292918
Max Phase: Preclinical
Molecular Formula: C28H36N4O2
Molecular Weight: 460.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](C(=O)N[C@@H](Cn1cc(C(C)(C)C)nn1)c1ccc(OCC2CCC2)cc1)c1ccccc1
Standard InChI: InChI=1S/C28H36N4O2/c1-20(22-11-6-5-7-12-22)27(33)29-25(17-32-18-26(30-31-32)28(2,3)4)23-13-15-24(16-14-23)34-19-21-9-8-10-21/h5-7,11-16,18,20-21,25H,8-10,17,19H2,1-4H3,(H,29,33)/t20-,25-/m0/s1
Standard InChI Key: LMXKBJUHVWVPIC-CPJSRVTESA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
16.5997 -10.5863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3096 -10.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6044 -9.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1225 -13.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1213 -14.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8335 -14.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5473 -14.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5444 -13.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8317 -13.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2547 -13.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9640 -13.5448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6743 -13.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3876 -13.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6712 -12.3123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3907 -14.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0979 -13.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8073 -13.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5171 -13.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5145 -12.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7961 -11.8933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0892 -12.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4092 -14.7896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2517 -12.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5383 -11.9076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4496 -11.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6455 -10.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2354 -11.6409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7887 -12.2501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6976 -14.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9855 -14.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1939 -14.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9818 -15.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7751 -15.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7887 -9.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 6
13 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
5 22 1 0
10 23 1 6
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 24 1 0
22 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 30 1 0
26 2 1 0
2 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.62Molecular Weight (Monoisotopic): 460.2838AlogP: 5.42#Rotatable Bonds: 9Polar Surface Area: 69.04Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.20CX Basic pKa: 0.46CX LogP: 6.20CX LogD: 6.20Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.16
References 1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C.. (2021) Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies., 64 (16.0): [PMID:34387471 ] [10.1021/acs.jmedchem.1c01075 ]