(2S)-N-[(1R)-2-(4-tert-Butyl-1H-1,2,3-triazol-1-yl)-1-[4-(cyclobutylmethoxy)phenyl]ethyl]-2-phenylpropanamide

ID: ALA5203098

PubChem CID: 168292918

Max Phase: Preclinical

Molecular Formula: C28H36N4O2

Molecular Weight: 460.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](C(=O)N[C@@H](Cn1cc(C(C)(C)C)nn1)c1ccc(OCC2CCC2)cc1)c1ccccc1

Standard InChI:  InChI=1S/C28H36N4O2/c1-20(22-11-6-5-7-12-22)27(33)29-25(17-32-18-26(30-31-32)28(2,3)4)23-13-15-24(16-14-23)34-19-21-9-8-10-21/h5-7,11-16,18,20-21,25H,8-10,17,19H2,1-4H3,(H,29,33)/t20-,25-/m0/s1

Standard InChI Key:  LMXKBJUHVWVPIC-CPJSRVTESA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   16.5997  -10.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3096  -10.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6044   -9.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1225  -13.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1213  -14.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8335  -14.7905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5473  -14.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5444  -13.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8317  -13.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2547  -13.1389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9640  -13.5448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6743  -13.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3876  -13.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6712  -12.3123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3907  -14.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0979  -13.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8073  -13.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5171  -13.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5145  -12.3032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7961  -11.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0892  -12.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4092  -14.7896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2517  -12.3176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5383  -11.9076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4496  -11.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6455  -10.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2354  -11.6409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7887  -12.2501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6976  -14.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9855  -14.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1939  -14.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9818  -15.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7751  -15.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7887   -9.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  6
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  5 22  1  0
 10 23  1  6
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 24  1  0
 22 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 30  1  0
 26  2  1  0
  2 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203098

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.62Molecular Weight (Monoisotopic): 460.2838AlogP: 5.42#Rotatable Bonds: 9
Polar Surface Area: 69.04Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.20CX Basic pKa: 0.46CX LogP: 6.20CX LogD: 6.20
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.16

References

1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C..  (2021)  Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies.,  64  (16.0): [PMID:34387471] [10.1021/acs.jmedchem.1c01075]

Source