1-[(2R)-2-[4-(Cyclobutylmethoxy)phenyl]-2-[(2S)-2-phenylpropanamido]ethyl]-N-methyl-1H-1,2,3-triazole-4-carboxamide

ID: ALA5203114

PubChem CID: 168293070

Max Phase: Preclinical

Molecular Formula: C26H31N5O3

Molecular Weight: 461.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cn(C[C@H](NC(=O)[C@@H](C)c2ccccc2)c2ccc(OCC3CCC3)cc2)nn1

Standard InChI:  InChI=1S/C26H31N5O3/c1-18(20-9-4-3-5-10-20)25(32)28-23(15-31-16-24(29-30-31)26(33)27-2)21-11-13-22(14-12-21)34-17-19-7-6-8-19/h3-5,9-14,16,18-19,23H,6-8,15,17H2,1-2H3,(H,27,33)(H,28,32)/t18-,23-/m0/s1

Standard InChI Key:  HGIJHYOQHFUWJH-MBSDFSHPSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   33.0866  -20.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0854  -21.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7976  -21.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5114  -21.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5086  -20.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7958  -19.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2189  -19.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9281  -20.2557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6384  -19.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3518  -20.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6353  -19.0232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.3548  -21.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0620  -19.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7714  -20.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4812  -19.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4786  -19.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7603  -18.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0534  -19.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3733  -21.5005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2158  -19.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5024  -18.6184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4137  -17.8052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6096  -17.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1995  -18.3517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7528  -18.9610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6618  -21.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9496  -21.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1580  -21.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9459  -22.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7392  -22.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2747  -16.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7529  -16.2301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4617  -16.8102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1269  -16.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  6
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 19  1  0
  7 20  1  6
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 27  1  0
 23 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203114

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.57Molecular Weight (Monoisotopic): 461.2427AlogP: 3.48#Rotatable Bonds: 10
Polar Surface Area: 98.14Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.60CX Basic pKa: CX LogP: 3.73CX LogD: 3.73
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.28

References

1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C..  (2021)  Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies.,  64  (16.0): [PMID:34387471] [10.1021/acs.jmedchem.1c01075]

Source