(trans)-(S)-4-(5-(hydroxymethyl)-2-methylphenoxy)-N-methyl-N-(3-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide

ID: ALA5203126

PubChem CID: 89723482

Max Phase: Preclinical

Molecular Formula: C29H41N3O3

Molecular Weight: 479.67

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(N(C)C(=O)[C@H]2CC[C@H](Oc3cc(CO)ccc3C)CC2)ccc1CN1CCN[C@@H](C)C1

Standard InChI:  InChI=1S/C29H41N3O3/c1-20-5-6-23(19-33)16-28(20)35-27-11-8-24(9-12-27)29(34)31(4)26-10-7-25(21(2)15-26)18-32-14-13-30-22(3)17-32/h5-7,10,15-16,22,24,27,30,33H,8-9,11-14,17-19H2,1-4H3/t22-,24-,27-/m0/s1

Standard InChI Key:  HOYGTZVNGBHQOX-DPPGTGKWSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -3.9276    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2131    1.8561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2131    0.2060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9276    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2131   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4988   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7844   -0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0726   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0726   -1.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7825   -2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4988   -1.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2131   -2.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3583   -2.2681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -1.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3583   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3583    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    1.4433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702    1.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0704    2.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7830    3.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4974    2.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4990    1.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7876    1.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702   -2.2681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3583   -3.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7843    1.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3561    3.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2133    1.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9276    1.8578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 13 14  1  0
 11 15  1  0
 15 16  1  0
 17 16  1  1
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 17 22  1  0
 20 23  1  6
 23 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 16 30  2  0
 15 31  1  0
  3 32  1  1
 25 33  1  0
 28 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.67Molecular Weight (Monoisotopic): 479.3148AlogP: 4.19#Rotatable Bonds: 7
Polar Surface Area: 65.04Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.35CX LogP: 4.22CX LogD: 2.28
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.62Np Likeness Score: -0.79

References

1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M..  (2022)  Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure.,  59  [PMID:35051575] [10.1016/j.bmcl.2022.128554]

Source