The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-methoxy-N-[(E)-3-[4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]allyl]acetamide ID: ALA5203179
PubChem CID: 137376541
Max Phase: Preclinical
Molecular Formula: C26H24N8O3
Molecular Weight: 496.53
Associated Items:
Names and Identifiers Canonical SMILES: COCC(=O)NC/C=C/c1ccc2ncnc(Nc3ccc(Oc4cc5nncn5cn4)c(C)c3)c2c1
Standard InChI: InChI=1S/C26H24N8O3/c1-17-10-19(6-8-22(17)37-25-12-23-33-31-16-34(23)15-30-25)32-26-20-11-18(5-7-21(20)28-14-29-26)4-3-9-27-24(35)13-36-2/h3-8,10-12,14-16H,9,13H2,1-2H3,(H,27,35)(H,28,29,32)/b4-3+
Standard InChI Key: LRPCGYUQHZRYLM-ONEGZZNKSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-1.7327 -1.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0182 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3063 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3063 -2.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0163 -2.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7327 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4114 -2.4745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1231 -2.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1212 -1.2368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4063 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4063 0.0007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1210 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1212 1.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8341 1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5489 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5505 0.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8386 -0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2635 1.6491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9782 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6928 1.6491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4074 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4074 0.4113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6928 -0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9782 0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8643 -0.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6849 -0.8945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0206 -0.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8341 2.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4474 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1621 -1.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8766 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5913 -1.2356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3060 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0206 -1.2356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3060 0.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5913 0.4147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8766 0.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
3 10 1 0
10 11 1 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 1 0
24 23 1 0
19 24 2 0
23 25 2 0
26 25 1 0
27 26 2 0
22 27 1 0
14 28 1 0
1 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
33 35 1 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.53Molecular Weight (Monoisotopic): 496.1971AlogP: 3.69#Rotatable Bonds: 9Polar Surface Area: 128.45Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.28CX LogP: 2.08CX LogD: 2.08Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.30
References 1. Li D, Tu Y, Jin K, Duan L, Hong Y, Xu J, Chen N, Zhang Z, Zuo H, Gong W, Zhang J, Wang Q, Qian H, Wang X, Ke Y, Xia G.. (2022) Discovery of SPH5030, a Selective, Potent, and Irreversible Tyrosine Kinase Inhibitor for HER2-Amplified and HER2-Mutant Cancer Treatment., 65 (7.0): [PMID:35319895 ] [10.1021/acs.jmedchem.1c00710 ]