((S)-4-(2-((S)-2-((2S,3S)-2-acetamido-3-methylpentanamido)-3-methylbutanamido)acetamido)-2,2-difluoro-3-oxopentanoyl)glycine

ID: ALA5203212

PubChem CID: 168292771

Max Phase: Preclinical

Molecular Formula: C22H35F2N5O8

Molecular Weight: 535.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C)C(=O)C(F)(F)C(=O)NCC(=O)O)C(C)C

Standard InChI:  InChI=1S/C22H35F2N5O8/c1-7-11(4)17(28-13(6)30)20(36)29-16(10(2)3)19(35)25-8-14(31)27-12(5)18(34)22(23,24)21(37)26-9-15(32)33/h10-12,16-17H,7-9H2,1-6H3,(H,25,35)(H,26,37)(H,27,31)(H,28,30)(H,29,36)(H,32,33)/t11-,12-,16-,17-/m0/s1

Standard InChI Key:  MUYLBDGWVJEFLX-SYWGBEHUSA-N

Molfile:  

 
     RDKit          2D

 37 36  0  0  0  0  0  0  0  0999 V2000
   -6.7882    0.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0736    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3590    0.6183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6444    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9298    0.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2152    0.2061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    0.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7859    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0713    0.6183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3567    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3578    0.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3578    1.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0724    0.2061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7868    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5014    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2158    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9303    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6448    0.6193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3592    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0738    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7882    0.2068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0738    1.4443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9303   -0.6181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6290    1.3351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8040    1.3351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5014   -0.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7868    1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7859   -0.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7859    1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2152    1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9298    1.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6444   -0.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9298   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3590   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3590   -1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0736   -0.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  6
  5  6  1  0
  6  7  1  0
  7  8  1  1
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 17 23  2  0
 16 24  1  0
 16 25  1  0
 15 26  2  0
 14 27  1  1
  8 28  2  0
  7 29  1  0
 29 30  1  0
 29 31  1  0
  5 32  2  0
  4 33  1  0
 33 34  1  1
 33 35  1  0
 35 36  1  0
  2 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5203212

    ---

Associated Targets(non-human)

SUB1 Subtilisin-like protease (110 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.55Molecular Weight (Monoisotopic): 535.2454AlogP: -1.30#Rotatable Bonds: 15
Polar Surface Area: 199.87Molecular Species: ACIDHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: -0.83CX LogD: -4.20
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.14Np Likeness Score: -0.36

References

1. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A..  (2022)  Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery.,  65  (19.0): [PMID:36137276] [10.1021/acs.jmedchem.2c01093]

Source