Dicyclopentyl ((E)-3-(4-(2-((adamantan-1-yl)acetoxy)-3-methoxyphenyl)acryloyl)glycyl-L-valyl-D-glutamate

ID: ALA5203244

PubChem CID: 168293004

Max Phase: Preclinical

Molecular Formula: C44H61N3O10

Molecular Weight: 791.98

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)NCC(=O)N[C@H](C(=O)N[C@H](CCC(=O)OC2CCCC2)C(=O)OC2CCCC2)C(C)C)ccc1OC(=O)CC12CC3CC(CC(C3)C1)C2

Standard InChI:  InChI=1S/C44H61N3O10/c1-27(2)41(42(52)46-34(43(53)56-33-10-6-7-11-33)14-17-39(50)55-32-8-4-5-9-32)47-38(49)26-45-37(48)16-13-28-12-15-35(36(21-28)54-3)57-40(51)25-44-22-29-18-30(23-44)20-31(19-29)24-44/h12-13,15-16,21,27,29-34,41H,4-11,14,17-20,22-26H2,1-3H3,(H,45,48)(H,46,52)(H,47,49)/b16-13+/t29?,30?,31?,34-,41+,44?/m1/s1

Standard InChI Key:  XGGYNBFZZADWFA-IRZWJBRBSA-N

Molfile:  

 
     RDKit          2D

 57 62  0  0  0  0  0  0  0  0999 V2000
   -1.3223    0.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6078    0.6350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3223   -0.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0370    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7516    0.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4662    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1067    0.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8213    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5360    0.2223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8213    1.4600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2506    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9653    0.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2506    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6800    0.6350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9653   -0.6028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3945    0.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1092    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8239    0.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5386    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2532    0.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9679    0.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3945   -0.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1092   -1.0154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6800   -1.0154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1092   -1.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5386    1.4600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9653    1.8727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5360    1.8727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1810    0.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8932    0.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8932    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1829    1.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4662    1.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1829    2.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8975    3.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6078    1.8727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3225    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0371    1.8727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3225    0.6349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2733    1.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6178    1.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7564    0.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3816    0.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5162    0.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9124    0.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3498    1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7518    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2396    1.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5196    0.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0540    1.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8608    1.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2733    0.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7213    0.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7765   -2.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5217   -3.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6969   -3.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4420   -2.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  1
 12 14  1  0
 12 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  6
 22 23  1  0
 22 24  2  0
 23 25  1  0
 19 26  2  0
 27 13  1  0
 13 28  1  0
 29  6  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
  6 33  1  0
 32 34  1  0
 34 35  1  0
 31 36  1  0
 36 37  1  0
 37 38  1  0
 37 39  2  0
 40 41  1  0
 40 42  1  0
 41 43  1  0
 42 44  1  0
 43 45  1  0
 44 45  1  0
 42 46  1  0
 46 47  1  0
 47 38  1  0
 41 48  1  0
 47 48  1  0
 45 49  1  0
 49 47  1  0
 50 21  1  0
 50 51  1  0
 51 52  1  0
 52 53  1  0
 53 21  1  0
 54 25  1  0
 54 55  1  0
 55 56  1  0
 56 57  1  0
 57 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203244

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 791.98Molecular Weight (Monoisotopic): 791.4357AlogP: 5.71#Rotatable Bonds: 18
Polar Surface Area: 175.43Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 3
CX Acidic pKa: 11.83CX Basic pKa: CX LogP: 5.48CX LogD: 5.48
Aromatic Rings: 1Heavy Atoms: 57QED Weighted: 0.09Np Likeness Score: -0.03

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source