The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-5-(3-trifluoromethoxyphenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione ID: ALA5203375
PubChem CID: 138505641
Max Phase: Preclinical
Molecular Formula: C14H11F3N4O3
Molecular Weight: 340.26
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc2c(c(=O)[nH]1)C(c1cccc(OC(F)(F)F)c1)CC(=O)N2
Standard InChI: InChI=1S/C14H11F3N4O3/c15-14(16,17)24-7-3-1-2-6(4-7)8-5-9(22)19-11-10(8)12(23)21-13(18)20-11/h1-4,8H,5H2,(H4,18,19,20,21,22,23)
Standard InChI Key: OFAJQDZKLHAKGN-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 26 0 0 0 0 0 0 0 0999 V2000
0.0000 -1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -1.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 -1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 -2.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -2.8857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -0.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0003 0.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 0.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4270 0.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4317 0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -2.8857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -2.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -1.6481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -1.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -0.4109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1432 -2.8856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1432 -2.8856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 1.2362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 2.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 2.4734 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 2.4734 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 2.8857 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 2 0
6 5 1 0
7 2 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
6 13 1 0
14 13 2 0
15 14 1 0
16 15 1 0
1 16 1 0
16 17 2 0
4 18 2 0
14 19 1 0
9 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 340.26Molecular Weight (Monoisotopic): 340.0783AlogP: 1.72#Rotatable Bonds: 2Polar Surface Area: 110.10Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.13CX Basic pKa: 1.86CX LogP: 1.57CX LogD: 1.51Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.77Np Likeness Score: -0.68
References 1. Takasaki I, Watanabe A, Okada T, Kanayama D, Nagashima R, Shudo M, Shimodaira A, Nunomura K, Lin B, Watanabe Y, Gouda H, Miyata A, Kurihara T, Toyooka N.. (2022) Design and synthesis of pyrido[2,3-d]pyrimidine derivatives for a novel PAC1 receptor antagonist., 231 [PMID:35124531 ] [10.1016/j.ejmech.2022.114160 ]