N-(2,6-difluorophenylsulfonyl)-2-methoxy-5-((1-methyl-5-nitro-1H-indol-3-yl)methyl)benzamide

ID: ALA5203389

PubChem CID: 168292942

Max Phase: Preclinical

Molecular Formula: C24H19F2N3O6S

Molecular Weight: 515.49

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cc2cn(C)c3ccc([N+](=O)[O-])cc23)cc1C(=O)NS(=O)(=O)c1c(F)cccc1F

Standard InChI:  InChI=1S/C24H19F2N3O6S/c1-28-13-15(17-12-16(29(31)32)7-8-21(17)28)10-14-6-9-22(35-2)18(11-14)24(30)27-36(33,34)23-19(25)4-3-5-20(23)26/h3-9,11-13H,10H2,1-2H3,(H,27,30)

Standard InChI Key:  KMYLVQXKFRJXJO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -3.2075   -1.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4929   -1.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7809   -1.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7809   -2.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4911   -3.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2075   -2.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9962   -2.9799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9962   -1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5112   -2.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9221   -1.4875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9221   -0.6623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6367   -1.9001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7826   -0.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0143   -0.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2281    0.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0230    0.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6067   -0.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3957   -1.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6003   -1.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4037    0.0049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9872   -0.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2366    1.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6531    1.7556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0337    1.3857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2472    2.1828    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.0443    2.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2582    3.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0530    3.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6367    2.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4257    2.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6303    1.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2472    3.0095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5326    2.5954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7827   -3.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4168    1.0133    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6747    3.7769    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
 10  1  1  0
 10 11  1  0
 10 12  2  0
  8 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 16 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 25 32  2  0
 25 33  2  0
  7 34  1  0
 31 35  1  0
 27 36  1  0
M  CHG  2  10   1  11  -1
M  END

Alternative Forms

  1. Parent:

    ALA5203389

    ---

Associated Targets(non-human)

Porphyromonas gingivalis (651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fusobacterium nucleatum (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Actinomyces naeslundii (215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Streptococcus sanguinis (314 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.49Molecular Weight (Monoisotopic): 515.0963AlogP: 4.08#Rotatable Bonds: 7
Polar Surface Area: 120.54Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.00CX Basic pKa: CX LogP: 4.90CX LogD: 3.96
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.20

References

1. Howard KC, Garneau-Tsodikova S..  (2022)  Selective Inhibition of the Periodontal Pathogen Porphyromonas gingivalis by Third-Generation Zafirlukast Derivatives.,  65  (21.0): [PMID:36273428] [10.1021/acs.jmedchem.2c01471]

Source