The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2,6-difluorophenylsulfonyl)-2-methoxy-5-((1-methyl-5-nitro-1H-indol-3-yl)methyl)benzamide ID: ALA5203389
PubChem CID: 168292942
Max Phase: Preclinical
Molecular Formula: C24H19F2N3O6S
Molecular Weight: 515.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2cn(C)c3ccc([N+](=O)[O-])cc23)cc1C(=O)NS(=O)(=O)c1c(F)cccc1F
Standard InChI: InChI=1S/C24H19F2N3O6S/c1-28-13-15(17-12-16(29(31)32)7-8-21(17)28)10-14-6-9-22(35-2)18(11-14)24(30)27-36(33,34)23-19(25)4-3-5-20(23)26/h3-9,11-13H,10H2,1-2H3,(H,27,30)
Standard InChI Key: KMYLVQXKFRJXJO-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-3.2075 -1.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4929 -1.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7809 -1.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7809 -2.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4911 -3.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2075 -2.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9962 -2.9799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9962 -1.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5112 -2.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9221 -1.4875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9221 -0.6623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6367 -1.9001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7826 -0.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0143 -0.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2281 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0230 0.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6067 -0.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3957 -1.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6003 -1.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4037 0.0049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9872 -0.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2366 1.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6531 1.7556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0337 1.3857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2472 2.1828 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0443 2.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2582 3.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0530 3.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6367 2.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4257 2.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6303 1.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2472 3.0095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5326 2.5954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7827 -3.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4168 1.0133 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.6747 3.7769 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
3 8 1 0
8 9 2 0
9 7 1 0
10 1 1 0
10 11 1 0
10 12 2 0
8 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
17 20 1 0
20 21 1 0
16 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
25 32 2 0
25 33 2 0
7 34 1 0
31 35 1 0
27 36 1 0
M CHG 2 10 1 11 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.49Molecular Weight (Monoisotopic): 515.0963AlogP: 4.08#Rotatable Bonds: 7Polar Surface Area: 120.54Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.00CX Basic pKa: ┄CX LogP: 4.90CX LogD: 3.96Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.20
References 1. Howard KC, Garneau-Tsodikova S.. (2022) Selective Inhibition of the Periodontal Pathogen Porphyromonas gingivalis by Third-Generation Zafirlukast Derivatives., 65 (21.0): [PMID:36273428 ] [10.1021/acs.jmedchem.2c01471 ]