The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(2-(5-(2-chlorophenyl)-3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl)-2-oxoethoxy)benzylidene)thiazolidine-2,4-dione ID: ALA5203530
PubChem CID: 168293179
Max Phase: Preclinical
Molecular Formula: C27H19ClFN3O4S
Molecular Weight: 535.98
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C\c2ccc(OCC(=O)N3N=C(c4ccc(F)cc4)CC3c3ccccc3Cl)cc2)S1
Standard InChI: InChI=1S/C27H19ClFN3O4S/c28-21-4-2-1-3-20(21)23-14-22(17-7-9-18(29)10-8-17)31-32(23)25(33)15-36-19-11-5-16(6-12-19)13-24-26(34)30-27(35)37-24/h1-13,23H,14-15H2,(H,30,34,35)/b24-13+
Standard InChI Key: DAUNZNGVBFJIKV-ZMOGYAJESA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-3.3652 0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8540 1.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5229 1.9368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0117 2.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8316 2.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1627 1.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6739 1.0903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6155 -0.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9453 -0.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9453 -1.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6525 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6525 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9309 -3.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2189 -2.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2189 -1.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2808 -0.2614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4947 -0.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3185 -1.3177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8849 0.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0989 -0.2065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5108 0.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2969 0.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9067 0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7305 1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3403 2.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1263 1.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3858 0.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9048 0.3121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2107 0.9823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4610 1.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2441 2.0327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7908 2.2541 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9444 1.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3346 1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5402 0.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2441 3.2250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.3672 -1.5791 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 2 2 0
1 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 10 2 0
16 9 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
27 29 1 0
30 29 1 0
30 31 2 0
32 30 1 0
32 26 1 0
24 33 2 0
33 34 1 0
34 21 2 0
35 16 1 0
1 35 2 0
5 36 1 0
11 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.98Molecular Weight (Monoisotopic): 535.0769AlogP: 5.56#Rotatable Bonds: 6Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.20CX Basic pKa: 0.52CX LogP: 5.04CX LogD: 4.64Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -1.68
References 1. Upadhyay N, Tilekar K, Safuan S, Kumar AP, Schweipert M, Meyer-Almes FJ, C S R.. (2021) Multi-target weapons: diaryl-pyrazoline thiazolidinediones simultaneously targeting VEGFR-2 and HDAC cancer hallmarks., 12 (9.0): [PMID:34671737 ] [10.1039/D1MD00125F ]