5-(4-(2-(5-(2-chlorophenyl)-3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl)-2-oxoethoxy)benzylidene)thiazolidine-2,4-dione

ID: ALA5203530

PubChem CID: 168293179

Max Phase: Preclinical

Molecular Formula: C27H19ClFN3O4S

Molecular Weight: 535.98

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)/C(=C\c2ccc(OCC(=O)N3N=C(c4ccc(F)cc4)CC3c3ccccc3Cl)cc2)S1

Standard InChI:  InChI=1S/C27H19ClFN3O4S/c28-21-4-2-1-3-20(21)23-14-22(17-7-9-18(29)10-8-17)31-32(23)25(33)15-36-19-11-5-16(6-12-19)13-24-26(34)30-27(35)37-24/h1-13,23H,14-15H2,(H,30,34,35)/b24-13+

Standard InChI Key:  DAUNZNGVBFJIKV-ZMOGYAJESA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -3.3652    0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8540    1.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5229    1.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0117    2.6014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8316    2.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1627    1.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6739    1.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6155   -0.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9453   -0.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9453   -1.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6525   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6525   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9309   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2189   -2.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2189   -1.9834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2808   -0.2614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4947   -0.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3185   -1.3177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8849    0.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0989   -0.2065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108    0.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2969    0.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9067    0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7305    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3403    2.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1263    1.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3858    0.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9048    0.3121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2107    0.9823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4610    1.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2441    2.0327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7908    2.2541    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.9444    1.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3346    1.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5402    0.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2441    3.2250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3672   -1.5791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  2  2  0
  1  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 10  2  0
 16  9  1  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 30 29  1  0
 30 31  2  0
 32 30  1  0
 32 26  1  0
 24 33  2  0
 33 34  1  0
 34 21  2  0
 35 16  1  0
  1 35  2  0
  5 36  1  0
 11 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203530

    ---

Associated Targets(Human)

HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC8 Tclin Histone deacetylase 8 (4516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.98Molecular Weight (Monoisotopic): 535.0769AlogP: 5.56#Rotatable Bonds: 6
Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.20CX Basic pKa: 0.52CX LogP: 5.04CX LogD: 4.64
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -1.68

References

1. Upadhyay N, Tilekar K, Safuan S, Kumar AP, Schweipert M, Meyer-Almes FJ, C S R..  (2021)  Multi-target weapons: diaryl-pyrazoline thiazolidinediones simultaneously targeting VEGFR-2 and HDAC cancer hallmarks.,  12  (9.0): [PMID:34671737] [10.1039/D1MD00125F]

Source