The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,4E)-5-(4-hydroxy-3-methoxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-1-(4-(pyrimidin-2-yl)piperazin-1-yl)penta-2,4-dien-1-one ID: ALA5203531
PubChem CID: 168293180
Max Phase: Preclinical
Molecular Formula: C27H28N4O5
Molecular Weight: 488.54
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C=C(/C(=O)N2CCN(c3ncccn3)CC2)c2ccc(O)c(OC)c2)ccc1O
Standard InChI: InChI=1S/C27H28N4O5/c1-35-24-17-19(7-9-22(24)32)5-3-6-21(20-8-10-23(33)25(18-20)36-2)26(34)30-13-15-31(16-14-30)27-28-11-4-12-29-27/h3-12,17-18,32-33H,13-16H2,1-2H3/b5-3+,21-6+
Standard InChI Key: QCBXNQKLXGCWFK-QGICWCDBSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-1.7784 -2.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4929 -1.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7784 -2.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4905 -3.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2025 -2.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2025 -2.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0713 -1.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0713 -0.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3642 -0.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3642 0.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3453 0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3453 1.6464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0573 0.4174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7728 0.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4885 0.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4885 -0.4032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7801 -0.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0573 -0.4072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2005 -0.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2005 -1.6364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9125 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6244 -1.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6244 -0.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9125 -0.3947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0762 0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0762 1.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 2.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5001 1.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5001 0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 0.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 2.8758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9134 -1.6426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6244 -2.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9134 -3.2842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2111 2.0570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0771 3.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
4 3 2 0
5 4 1 0
2 6 1 0
6 5 2 0
1 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
11 12 2 0
13 11 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 18 1 0
19 16 1 0
20 19 2 0
20 21 1 0
22 21 2 0
23 22 1 0
19 24 1 0
24 23 2 0
25 10 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
27 31 1 0
6 32 1 0
32 33 1 0
5 34 1 0
28 35 1 0
31 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.54Molecular Weight (Monoisotopic): 488.2060AlogP: 3.35#Rotatable Bonds: 7Polar Surface Area: 108.25Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.41CX Basic pKa: 3.20CX LogP: 3.54CX LogD: 3.54Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.44
References 1. Fang Y, Tan Q, Zhou H, Gu Q, Xu J.. (2022) Discovery of novel diphenylbutene derivative ferroptosis inhibitors as neuroprotective agents., 231 [PMID:35123296 ] [10.1016/j.ejmech.2022.114151 ]