The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-cyclohexyl-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-2,3-dihydro-1,4-benzoxazine-8-carboxamide ID: ALA5203545
PubChem CID: 168293237
Max Phase: Preclinical
Molecular Formula: C35H45N5O3
Molecular Weight: 583.78
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(CNC(=O)c2cc(-c3ccc(CN4CCN(C)CC4)cc3)cc3c2OCCN3C2CCCCC2)c(=O)[nH]1
Standard InChI: InChI=1S/C35H45N5O3/c1-24-19-25(2)37-35(42)31(24)22-36-34(41)30-20-28(21-32-33(30)43-18-17-40(32)29-7-5-4-6-8-29)27-11-9-26(10-12-27)23-39-15-13-38(3)14-16-39/h9-12,19-21,29H,4-8,13-18,22-23H2,1-3H3,(H,36,41)(H,37,42)
Standard InChI Key: XCIZQFHXHRURGG-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
-2.1778 1.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4697 1.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7515 1.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0432 1.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0557 2.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6507 2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3719 2.3483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0796 2.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3861 1.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6808 1.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7387 0.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4424 -0.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4297 -0.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7089 -1.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1380 -1.4168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1253 -2.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8335 -2.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5544 -2.2640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5672 -1.4388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2627 -2.6875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2500 -3.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9582 -3.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5290 -3.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8208 -3.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0999 -3.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1651 0.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8733 -0.1946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8010 2.3715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5999 0.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6126 1.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 1.4605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 2.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6163 2.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6163 3.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 3.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1869 3.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1869 2.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5088 2.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2301 2.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2436 1.5698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5357 1.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8145 1.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9582 1.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
3 4 1 0
5 4 2 0
6 5 1 0
7 6 2 0
7 8 1 0
9 7 1 0
10 9 2 0
4 10 1 0
11 3 2 0
12 11 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
23 24 1 0
24 17 2 0
24 25 1 0
26 12 2 0
1 26 1 0
26 27 1 0
8 28 1 0
29 27 1 0
30 29 1 0
31 30 1 0
1 31 1 0
31 32 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
32 37 1 0
38 28 1 0
39 38 1 0
40 39 1 0
41 40 1 0
42 41 1 0
28 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.78Molecular Weight (Monoisotopic): 583.3522AlogP: 4.87#Rotatable Bonds: 7Polar Surface Area: 80.91Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.64CX Basic pKa: 8.15CX LogP: 4.16CX LogD: 3.34Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.41Np Likeness Score: -1.14
References 1. Xia J, Li J, Tian L, Ren X, Liu C, Liang C.. (2022) Targeting Enhancer of Zeste Homolog 2 for the Treatment of Hematological Malignancies and Solid Tumors: Candidate Structure-Activity Relationships Insights and Evolution Prospects., 65 (10.0): [PMID:35531606 ] [10.1021/acs.jmedchem.2c00047 ]