The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3,5-difluorophenyl)-N-((1R,2S)-2-(methylcarbamoyl)cyclohexyl)benzo[d]isothiazole-3-carboxamide ID: ALA5203562
PubChem CID: 168293392
Max Phase: Preclinical
Molecular Formula: C22H21F2N3O2S
Molecular Weight: 429.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@H]1CCCC[C@H]1NC(=O)c1nsc2ccc(-c3cc(F)cc(F)c3)cc12
Standard InChI: InChI=1S/C22H21F2N3O2S/c1-25-21(28)16-4-2-3-5-18(16)26-22(29)20-17-10-12(6-7-19(17)30-27-20)13-8-14(23)11-15(24)9-13/h6-11,16,18H,2-5H2,1H3,(H,25,28)(H,26,29)/t16-,18+/m0/s1
Standard InChI Key: ANHRGAFRGMKIGH-FUHWJXTLSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-1.6618 2.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6618 1.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9484 0.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2414 1.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2414 2.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9502 2.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5400 2.2803 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0230 1.6155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5400 0.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7526 0.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5463 -0.0555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7590 -0.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5527 -1.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7654 -1.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1843 -2.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3907 -2.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1780 -1.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1337 -0.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9210 0.3128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9274 -0.6935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5084 -0.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1716 -0.4239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3734 0.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0880 1.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7969 0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7969 -0.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0834 -0.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3734 -0.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0834 -1.2621 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5084 1.1989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 2 0
4 9 1 0
9 10 1 0
10 11 1 0
12 11 1 1
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 1 0
13 18 1 1
18 19 2 0
18 20 1 0
20 21 1 0
10 22 2 0
23 2 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
27 29 1 0
25 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.49Molecular Weight (Monoisotopic): 429.1323AlogP: 4.28#Rotatable Bonds: 4Polar Surface Area: 71.09Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.03CX LogD: 4.03Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.08
References 1. Proj M, Bozovičar K, Hrast M, Frlan R, Gobec S.. (2022) DNA-encoded library screening on two validated enzymes of the peptidoglycan biosynthetic pathway., 73 [PMID:35917835 ] [10.1016/j.bmcl.2022.128915 ]