5-(3,5-difluorophenyl)-N-((1R,2S)-2-(methylcarbamoyl)cyclohexyl)benzo[d]isothiazole-3-carboxamide

ID: ALA5203562

PubChem CID: 168293392

Max Phase: Preclinical

Molecular Formula: C22H21F2N3O2S

Molecular Weight: 429.49

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)[C@H]1CCCC[C@H]1NC(=O)c1nsc2ccc(-c3cc(F)cc(F)c3)cc12

Standard InChI:  InChI=1S/C22H21F2N3O2S/c1-25-21(28)16-4-2-3-5-18(16)26-22(29)20-17-10-12(6-7-19(17)30-27-20)13-8-14(23)11-15(24)9-13/h6-11,16,18H,2-5H2,1H3,(H,25,28)(H,26,29)/t16-,18+/m0/s1

Standard InChI Key:  ANHRGAFRGMKIGH-FUHWJXTLSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -1.6618    2.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6618    1.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9484    0.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2414    1.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2414    2.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9502    2.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5400    2.2803    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0230    1.6155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5400    0.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7526    0.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5463   -0.0555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7590   -0.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5527   -1.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7654   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1843   -2.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3907   -2.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1780   -1.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1337   -0.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9210    0.3128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9274   -0.6935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5084   -0.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1716   -0.4239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3734    0.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0880    1.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7969    0.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7969   -0.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0834   -0.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3734   -0.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0834   -1.2621    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5084    1.1989    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  1
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  1  0
 13 18  1  1
 18 19  2  0
 18 20  1  0
 20 21  1  0
 10 22  2  0
 23  2  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 23  2  0
 27 29  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203562

    ---

Associated Targets(non-human)

ddlB D-alanylalanine synthetase (66 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.49Molecular Weight (Monoisotopic): 429.1323AlogP: 4.28#Rotatable Bonds: 4
Polar Surface Area: 71.09Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.03CX LogD: 4.03
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.08

References

1. Proj M, Bozovičar K, Hrast M, Frlan R, Gobec S..  (2022)  DNA-encoded library screening on two validated enzymes of the peptidoglycan biosynthetic pathway.,  73  [PMID:35917835] [10.1016/j.bmcl.2022.128915]

Source