The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl ((2R,5R)-6-methyl-3-oxo-1-phenyl-5-((4-sulfamoylphenethyl)carbamoyl)heptan-2-yl)carbamate ID: ALA5203578
PubChem CID: 168293434
Max Phase: Preclinical
Molecular Formula: C31H37N3O6S
Molecular Weight: 579.72
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@@H](CC(=O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)NCCc1ccc(S(N)(=O)=O)cc1
Standard InChI: InChI=1S/C31H37N3O6S/c1-22(2)27(30(36)33-18-17-23-13-15-26(16-14-23)41(32,38)39)20-29(35)28(19-24-9-5-3-6-10-24)34-31(37)40-21-25-11-7-4-8-12-25/h3-16,22,27-28H,17-21H2,1-2H3,(H,33,36)(H,34,37)(H2,32,38,39)/t27-,28-/m1/s1
Standard InChI Key: XOGCOHICXHZUBW-VSGBNLITSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
-1.7865 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7865 0.8247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 -0.4131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5011 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2158 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9304 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6453 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3574 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3574 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6470 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9304 -0.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0720 -0.8255 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.7866 -0.4129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6586 -1.5415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4837 -1.5415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5011 0.8248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2157 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9304 0.8248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2157 -0.4129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6451 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3597 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0746 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7866 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7866 1.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0763 2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3597 1.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7865 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3570 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3550 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3550 -1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3552 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 -1.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
14 17 1 0
17 18 1 0
17 19 2 0
17 20 2 0
1 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
1 32 1 1
32 33 1 0
34 33 2 0
35 34 1 0
36 35 2 0
37 36 1 0
38 37 2 0
33 38 1 0
5 39 1 6
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.72Molecular Weight (Monoisotopic): 579.2403AlogP: 3.76#Rotatable Bonds: 14Polar Surface Area: 144.66Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.22CX Basic pKa: ┄CX LogP: 4.71CX LogD: 4.70Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.27Np Likeness Score: -0.47