The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-hydroxyphenyl)(4-(3-(pyridin-2-yloxy)benzyl)piperidin-1-yl)methanone ID: ALA5203586
PubChem CID: 168293185
Max Phase: Preclinical
Molecular Formula: C24H24N2O3
Molecular Weight: 388.47
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cccc(O)c1)N1CCC(Cc2cccc(Oc3ccccn3)c2)CC1
Standard InChI: InChI=1S/C24H24N2O3/c27-21-7-4-6-20(17-21)24(28)26-13-10-18(11-14-26)15-19-5-3-8-22(16-19)29-23-9-1-2-12-25-23/h1-9,12,16-18,27H,10-11,13-15H2
Standard InChI Key: DPVDZJYGQWZYEY-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-2.1339 0.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1350 -0.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4223 -0.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7080 -0.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7108 0.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4241 0.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8478 -0.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5599 -0.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5546 0.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2658 0.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9796 0.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9776 -0.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2657 -0.8178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0050 -0.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7168 -0.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4242 -0.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1338 -0.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1367 0.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4239 0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7080 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8501 0.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5616 0.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8519 1.6458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5546 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2652 -0.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9796 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9788 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2675 0.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2630 -1.6458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 20 1 0
19 20 1 0
18 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
25 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.47Molecular Weight (Monoisotopic): 388.1787AlogP: 4.67#Rotatable Bonds: 5Polar Surface Area: 62.66Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.82CX Basic pKa: 1.95CX LogP: 4.56CX LogD: 4.54Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.03
References 1. Bononi G, Di Stefano M, Poli G, Ortore G, Meier P, Masetto F, Caligiuri I, Rizzolio F, Macchia M, Chicca A, Avan A, Giovannetti E, Vagaggini C, Brai A, Dreassi E, Valoti M, Minutolo F, Granchi C, Gertsch J, Tuccinardi T.. (2022) Reversible Monoacylglycerol Lipase Inhibitors: Discovery of a New Class of Benzylpiperidine Derivatives., 65 (10.0): [PMID:35522977 ] [10.1021/acs.jmedchem.1c01806 ]