2-(1-Ethyl-3-methyl-1H-pyrazole-5-carboxamido)-1-(4-(nicotinamido)butyl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA5203628

PubChem CID: 164903408

Max Phase: Preclinical

Molecular Formula: C25H28N8O3

Molecular Weight: 488.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)ccc2n1CCCCNC(=O)c1cccnc1

Standard InChI:  InChI=1S/C25H28N8O3/c1-3-33-21(13-16(2)31-33)24(36)30-25-29-19-14-17(22(26)34)8-9-20(19)32(25)12-5-4-11-28-23(35)18-7-6-10-27-15-18/h6-10,13-15H,3-5,11-12H2,1-2H3,(H2,26,34)(H,28,35)(H,29,30,36)

Standard InChI Key:  XNIMGAPJZQHCOC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -2.4326   -0.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4338   -1.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7211   -1.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0092   -1.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0095   -0.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7228   -0.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2259   -0.2354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2587   -0.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2255   -1.5687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0813   -0.9015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4923   -0.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3149   -0.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7959   -0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5781   -0.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5778    0.2233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7954    0.4771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5823    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1642    1.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2907   -1.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0808    0.5231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0279    0.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5227    1.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2687    1.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8195    2.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6242    2.3807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8782    1.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6830    1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9371    0.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7397    0.4741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2907    1.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0395    1.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2362    2.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.0164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1465   -1.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1471   -2.5520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8586   -1.3176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  4  1  0
  5  6  2  0
  6  1  1  0
  7  5  1  0
  8  7  1  0
  9  8  2  0
  4  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 16 17  1  0
 17 18  1  0
 14 19  1  0
 11 20  2  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 26 33  2  0
  2 34  1  0
 34 35  2  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203628

    ---

Associated Targets(Human)

STING1 Tchem Stimulator of interferon genes protein (1885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
THP1-Dual (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.55Molecular Weight (Monoisotopic): 488.2284AlogP: 2.52#Rotatable Bonds: 10
Polar Surface Area: 149.82Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.33CX Basic pKa: 3.62CX LogP: 1.18CX LogD: 1.18
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -2.02

References

1. Jeon MJ, Lee H, Lee J, Baek SY, Lee D, Jo S, Lee JY, Kang M, Jung HR, Han SB, Kim NJ, Lee S, Kim H..  (2022)  Development of Potent Immune Modulators Targeting Stimulator of Interferon Genes Receptor.,  65  (7.0): [PMID:35315650] [10.1021/acs.jmedchem.1c01795]

Source