5-(4-(diethylamino)butoxy)-2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one

ID: ALA5203679

PubChem CID: 168293262

Max Phase: Preclinical

Molecular Formula: C27H35NO7

Molecular Weight: 485.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCCOc1cc(OC)cc2oc(-c3ccc(OC)c(OC)c3)c(OC)c(=O)c12

Standard InChI:  InChI=1S/C27H35NO7/c1-7-28(8-2)13-9-10-14-34-22-16-19(30-3)17-23-24(22)25(29)27(33-6)26(35-23)18-11-12-20(31-4)21(15-18)32-5/h11-12,15-17H,7-10,13-14H2,1-6H3

Standard InChI Key:  XTVYVVAUYIMCJJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   -1.7788    2.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7788    1.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0653    1.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3581    1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3581    2.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0672    2.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3534    2.6711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0650    2.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0650    1.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3534    1.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3534    0.2059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7767    1.0277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4884    1.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7767    2.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7767    3.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4869    3.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2003    3.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2003    2.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4915    2.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9120    2.2624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6237    2.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9104    3.9019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6221    3.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0653    0.2067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7770   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7770   -1.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4887   -1.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4887   -2.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2004   -2.6694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2004   -3.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9121   -3.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9121   -2.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6237   -2.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4904    2.6709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2021    2.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
  8 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 18 20  1  0
 20 21  1  0
 17 22  1  0
 22 23  1  0
  3 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
 32 33  1  0
  1 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203679

    ---

Associated Targets(Human)

dsDNA (365 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2414AlogP: 5.00#Rotatable Bonds: 13
Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.62CX LogP: 3.51CX LogD: 1.31
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: 0.19

References

1. Rangel VM, Gu L, Chen G, Chen QH, Xue L..  (2022)  5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands.,  61  [PMID:35143982] [10.1016/j.bmcl.2022.128608]

Source