The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(diethylamino)butoxy)-2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one ID: ALA5203679
PubChem CID: 168293262
Max Phase: Preclinical
Molecular Formula: C27H35NO7
Molecular Weight: 485.58
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCCOc1cc(OC)cc2oc(-c3ccc(OC)c(OC)c3)c(OC)c(=O)c12
Standard InChI: InChI=1S/C27H35NO7/c1-7-28(8-2)13-9-10-14-34-22-16-19(30-3)17-23-24(22)25(29)27(33-6)26(35-23)18-11-12-20(31-4)21(15-18)32-5/h11-12,15-17H,7-10,13-14H2,1-6H3
Standard InChI Key: XTVYVVAUYIMCJJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
-1.7788 2.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7788 1.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0653 1.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 1.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 2.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0672 2.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3534 2.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0650 2.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0650 1.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3534 1.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3534 0.2059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7767 1.0277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4884 1.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7767 2.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7767 3.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4869 3.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2003 3.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2003 2.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4915 2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9120 2.2624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6237 2.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9104 3.9019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6221 3.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0653 0.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7770 -0.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7770 -1.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4887 -1.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4887 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2004 -2.6694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2004 -3.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9121 -3.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9121 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6237 -2.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4904 2.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2021 2.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
10 11 2 0
9 12 1 0
12 13 1 0
8 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
18 20 1 0
20 21 1 0
17 22 1 0
22 23 1 0
3 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
29 32 1 0
32 33 1 0
1 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2414AlogP: 5.00#Rotatable Bonds: 13Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.62CX LogP: 3.51CX LogD: 1.31Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: 0.19
References 1. Rangel VM, Gu L, Chen G, Chen QH, Xue L.. (2022) 5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands., 61 [PMID:35143982 ] [10.1016/j.bmcl.2022.128608 ]