4-[1-(benzenesulfonyl)indol-2-yl]-N-(3-imidazol-1-ylpropyl)butanamide

ID: ALA5203883

PubChem CID: 168293417

Max Phase: Preclinical

Molecular Formula: C24H26N4O3S

Molecular Weight: 450.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCc1cc2ccccc2n1S(=O)(=O)c1ccccc1)NCCCn1ccnc1

Standard InChI:  InChI=1S/C24H26N4O3S/c29-24(26-14-7-16-27-17-15-25-19-27)13-6-9-21-18-20-8-4-5-12-23(20)28(21)32(30,31)22-10-2-1-3-11-22/h1-5,8,10-12,15,17-19H,6-7,9,13-14,16H2,(H,26,29)

Standard InChI Key:  XMFBIZSMJCJMHW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -1.9382   -0.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1577    0.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6057    0.9141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2173    1.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9621    0.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6694    1.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8618    1.7020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8520    0.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7452   -0.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1576   -1.1277    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9825   -1.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7452   -1.8420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3328   -1.1277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2175   -0.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3951   -0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6300   -1.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2211   -1.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3967   -1.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3550   -0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6338   -0.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4678   -0.8771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7535   -0.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0734   -0.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7535    0.3601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1821   -0.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8965   -0.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6108   -0.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3251   -0.8771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4113   -1.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2178   -1.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6300   -1.1545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0783   -0.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  4  5  2  0
  2  5  1  0
  6  4  1  0
  7  6  2  0
  3  7  1  0
  1  8  2  0
  3  8  1  0
  1  9  1  0
  2  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 10 13  2  0
 14 15  1  0
 15 11  2  0
 16 14  2  0
 17 16  1  0
 18 17  2  0
 11 18  1  0
  1 19  1  0
 19 20  1  0
 21 22  1  0
 22 23  1  0
 20 23  1  0
 22 24  2  0
 21 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 29 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5203883

    ---

Associated Targets(Human)

IDE Tchem Insulin-degrading enzyme (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1726AlogP: 3.60#Rotatable Bonds: 10
Polar Surface Area: 85.99Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.79CX LogP: 2.68CX LogD: 2.61
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.36

References

1. Kraupner N, Dinh CP, Wen X, Landry V, Herledan A, Leroux F, Bosc D, Charton J, Maillard C, Warenghem S, Duplan I, Piveteau C, Hennuyer N, Staels B, Deprez B, Deprez-Poulain R..  (2022)  Identification of indole-based activators of insulin degrading enzyme.,  228  [PMID:34815130] [10.1016/j.ejmech.2021.113982]

Source