The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(5-Chloro-2-methyl-phenyl)piperazin-1-yl)-2-(4-methoxybenzoylamino)benzoicAcid Methyl Ester ID: ALA5203907
PubChem CID: 146347198
Max Phase: Preclinical
Molecular Formula: C27H28ClN3O4
Molecular Weight: 493.99
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(N2CCN(c3cc(Cl)ccc3C)CC2)ccc1NC(=O)c1ccc(OC)cc1
Standard InChI: InChI=1S/C27H28ClN3O4/c1-18-4-7-20(28)16-25(18)31-14-12-30(13-15-31)21-8-11-24(23(17-21)27(33)35-3)29-26(32)19-5-9-22(34-2)10-6-19/h4-11,16-17H,12-15H2,1-3H3,(H,29,32)
Standard InChI Key: DPPFOTXUDBSLKJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-5.9574 -0.1999 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.3741 0.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5629 0.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0385 0.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3294 1.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7460 2.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1436 1.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6639 1.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2247 0.7492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9350 -0.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1210 -0.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5966 0.4783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8864 1.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7004 1.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7828 0.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4918 -0.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3221 -0.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6117 -1.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0876 -1.9729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4256 -1.4712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7152 -2.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8424 0.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5527 0.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2584 0.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6562 -0.0638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1804 0.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8907 1.3456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9942 0.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2851 -0.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0992 -0.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6195 0.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3298 0.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5186 1.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4334 0.0309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9574 0.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
5 7 2 0
7 8 1 0
8 2 2 0
9 4 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
9 14 1 0
15 12 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
17 22 1 0
22 23 2 0
23 24 1 0
24 15 2 0
22 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 28 2 0
31 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.99Molecular Weight (Monoisotopic): 493.1768AlogP: 5.02#Rotatable Bonds: 6Polar Surface Area: 71.11Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.98CX LogP: 6.52CX LogD: 6.52Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.49Np Likeness Score: -1.44
References 1. Dobrovolskaite A, Moots H, Tantak MP, Shah K, Thomas J, Dinara S, Massaro C, Hershberger PM, Maloney PR, Peddibhotla S, Sugarman E, Litherland S, Arnoletti JP, Jha RK, Levens D, Phanstiel O.. (2022) Discovery of Anthranilic Acid Derivatives as Difluoromethylornithine Adjunct Agents That Inhibit Far Upstream Element Binding Protein 1 (FUBP1) Function., 65 (22.0): [PMID:36382923 ] [10.1021/acs.jmedchem.2c01350 ]