The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-5-(3,4-diethoxyphenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione ID: ALA5203927
PubChem CID: 138505646
Max Phase: Preclinical
Molecular Formula: C17H20N4O4
Molecular Weight: 344.37
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(C2CC(=O)Nc3nc(N)[nH]c(=O)c32)cc1OCC
Standard InChI: InChI=1S/C17H20N4O4/c1-3-24-11-6-5-9(7-12(11)25-4-2)10-8-13(22)19-15-14(10)16(23)21-17(18)20-15/h5-7,10H,3-4,8H2,1-2H3,(H4,18,19,20,21,22,23)
Standard InChI Key: OTRHDVONJDJOQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
0.0000 -1.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -1.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 -1.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 -2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -3.0920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -0.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0003 -0.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4270 0.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4317 -0.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -3.0920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -2.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 -1.8544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -1.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -0.6172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1432 -3.0918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1432 -3.0918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 1.0300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 1.8548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0012 2.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0012 3.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1416 1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 2 0
6 5 1 0
7 2 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
6 13 1 0
14 13 2 0
15 14 1 0
16 15 1 0
1 16 1 0
16 17 2 0
4 18 2 0
14 19 1 0
9 20 1 0
10 21 1 0
21 22 1 0
22 23 1 0
20 24 1 0
24 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 344.37Molecular Weight (Monoisotopic): 344.1485AlogP: 1.62#Rotatable Bonds: 5Polar Surface Area: 119.33Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.98CX Basic pKa: 1.96CX LogP: 0.54CX LogD: 0.45Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.76Np Likeness Score: -0.39
References 1. Takasaki I, Watanabe A, Okada T, Kanayama D, Nagashima R, Shudo M, Shimodaira A, Nunomura K, Lin B, Watanabe Y, Gouda H, Miyata A, Kurihara T, Toyooka N.. (2022) Design and synthesis of pyrido[2,3-d]pyrimidine derivatives for a novel PAC1 receptor antagonist., 231 [PMID:35124531 ] [10.1016/j.ejmech.2022.114160 ]