The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (Z)-5-((4-(ethoxycarbonyl)-3-oxo-5-(phenylamino)thiophen-2(3H)-ylidene)methyl)-1H-pyrrole-2-carboxylate ID: ALA5204244
PubChem CID: 168294088
Max Phase: Preclinical
Molecular Formula: C21H20N2O5S
Molecular Weight: 412.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(Nc2ccccc2)S/C(=C\c2ccc(C(=O)OCC)[nH]2)C1=O
Standard InChI: InChI=1S/C21H20N2O5S/c1-3-27-20(25)15-11-10-14(22-15)12-16-18(24)17(21(26)28-4-2)19(29-16)23-13-8-6-5-7-9-13/h5-12,22-23H,3-4H2,1-2H3/b16-12-
Standard InChI Key: DLOVKJDJQHUCOZ-VBKFSLOCSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
1.0540 -0.1942 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3866 0.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6415 1.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4665 1.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7214 0.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5183 0.0772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7318 -0.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5286 -0.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7407 -1.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1573 -2.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3640 -2.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1459 -1.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8790 1.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4665 2.5041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8790 3.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7039 3.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7039 1.7898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2290 1.7898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4101 0.0772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6236 -0.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1047 -1.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5538 -2.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3502 -1.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3934 -1.0150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9336 -2.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7200 -3.2186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7304 -2.2083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9439 -1.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7407 -1.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
5 6 1 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
4 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
13 17 2 0
3 18 2 0
2 19 2 0
19 20 1 0
21 20 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
23 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.47Molecular Weight (Monoisotopic): 412.1093AlogP: 3.74#Rotatable Bonds: 7Polar Surface Area: 97.49Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.87CX Basic pKa: ┄CX LogP: 4.01CX LogD: 4.01Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.41Np Likeness Score: -0.64
References 1. Hwang J, Qiu X, Borgelt L, Haacke N, Kanis L, Petroulia S, Gasper R, Schiller D, Lampe P, Sievers S, Imig J, Wu P.. (2022) Synthesis and evaluation of RNase L-binding 2-aminothiophenes as anticancer agents., 58 [PMID:35152173 ] [10.1016/j.bmc.2022.116653 ]