((S)-2,2-difluoro-4-(2-((S)-3-methyl-2-(2-phenylacetamido)butanamido)acetamido)-3-oxopentanoyl)glycine

ID: ALA5204305

PubChem CID: 168293661

Max Phase: Preclinical

Molecular Formula: C22H28F2N4O7

Molecular Weight: 498.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)NCC(=O)N[C@@H](C)C(=O)C(F)(F)C(=O)NCC(=O)O

Standard InChI:  InChI=1S/C22H28F2N4O7/c1-12(2)18(28-15(29)9-14-7-5-4-6-8-14)20(34)25-10-16(30)27-13(3)19(33)22(23,24)21(35)26-11-17(31)32/h4-8,12-13,18H,9-11H2,1-3H3,(H,25,34)(H,26,35)(H,27,30)(H,28,29)(H,31,32)/t13-,18-/m0/s1

Standard InChI Key:  GNKYPFZGPQNMGU-UGSOOPFHSA-N

Molfile:  

 
     RDKit          2D

 35 35  0  0  0  0  0  0  0  0999 V2000
   -4.6452   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306    0.8245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2161   -0.4122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5015    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5015    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2161    1.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7869    1.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7869   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0724    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3578   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567    0.8245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712   -0.4122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6277    0.7166    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8028    0.7166    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9288   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6432    0.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3576   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0721    0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0721    0.8258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7866   -0.4115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9288   -1.2364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -1.2367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7869   -1.2367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3598    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0743   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7863   -0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7866    0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0766    1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3601    0.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  5  9  1  1
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 21 27  2  0
 17 28  2  0
  9 29  2  0
 30  1  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5204305

    ---

Associated Targets(non-human)

SUB1 Subtilisin-like protease (110 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.48Molecular Weight (Monoisotopic): 498.1926AlogP: -0.60#Rotatable Bonds: 13
Polar Surface Area: 170.77Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: 0.20CX LogD: -3.16
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -0.63

References

1. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A..  (2022)  Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery.,  65  (19.0): [PMID:36137276] [10.1021/acs.jmedchem.2c01093]

Source