The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((S)-2,2-difluoro-4-(2-((S)-3-methyl-2-(2-phenylacetamido)butanamido)acetamido)-3-oxopentanoyl)glycine ID: ALA5204305
PubChem CID: 168293661
Max Phase: Preclinical
Molecular Formula: C22H28F2N4O7
Molecular Weight: 498.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)NCC(=O)N[C@@H](C)C(=O)C(F)(F)C(=O)NCC(=O)O
Standard InChI: InChI=1S/C22H28F2N4O7/c1-12(2)18(28-15(29)9-14-7-5-4-6-8-14)20(34)25-10-16(30)27-13(3)19(33)22(23,24)21(35)26-11-17(31)32/h4-8,12-13,18H,9-11H2,1-3H3,(H,25,34)(H,26,35)(H,27,30)(H,28,29)(H,31,32)/t13-,18-/m0/s1
Standard InChI Key: GNKYPFZGPQNMGU-UGSOOPFHSA-N
Molfile:
RDKit 2D
35 35 0 0 0 0 0 0 0 0999 V2000
-4.6452 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9306 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9306 0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2161 -0.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5015 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5015 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2161 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7869 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7869 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0724 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3578 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3567 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3567 0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0712 -0.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7855 0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7855 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5001 -0.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6277 0.7166 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8028 0.7166 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9288 -0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6432 0.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3576 -0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0721 0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0721 0.8258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7866 -0.4115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9288 -1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5001 -1.2367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7869 -1.2367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3598 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0743 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7863 -0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7866 0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0766 1.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3601 0.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 1 0
5 9 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
21 27 2 0
17 28 2 0
9 29 2 0
30 1 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
30 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.48Molecular Weight (Monoisotopic): 498.1926AlogP: -0.60#Rotatable Bonds: 13Polar Surface Area: 170.77Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.56CX Basic pKa: ┄CX LogP: 0.20CX LogD: -3.16Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -0.63
References 1. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A.. (2022) Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery., 65 (19.0): [PMID:36137276 ] [10.1021/acs.jmedchem.2c01093 ]