dimethyl 4-(1H-indol-3-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate

ID: ALA5204506

PubChem CID: 5057943

Max Phase: Preclinical

Molecular Formula: C19H20N2O4

Molecular Weight: 340.38

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1c[nH]c2ccccc12

Standard InChI:  InChI=1S/C19H20N2O4/c1-10-15(18(22)24-3)17(16(11(2)21-10)19(23)25-4)13-9-20-14-8-6-5-7-12(13)14/h5-9,17,20-21H,1-4H3

Standard InChI Key:  OYIYJVINXLABDJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   -0.7119    1.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7119    0.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    0.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    1.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -0.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4259    0.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1409    0.9331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8547    0.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4246   -0.3033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4276    2.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4277    2.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4259    0.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4247   -0.3033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1408    0.9331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8547    0.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4124   -1.5692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6673   -0.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4117   -1.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6631   -0.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4660   -0.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0182   -1.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7620   -2.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9598   -2.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  1  6  1  0
  5  6  1  0
  3  7  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  2  0
  1 12  1  0
  5 13  1  0
  4 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 18 19  1  0
 19  7  2  0
 20 18  1  0
  7 21  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
M  END

Associated Targets(Human)

PDE1C Tclin Phosphodiesterase 1C (228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.38Molecular Weight (Monoisotopic): 340.1423AlogP: 2.75#Rotatable Bonds: 3
Polar Surface Area: 80.42Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.97CX LogD: 1.97
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.84Np Likeness Score: -0.25

References

1. Huang MX, Tian YJ, Han C, Liu RD, Xie X, Yuan Y, Yang YY, Li Z, Chen J, Luo HB, Wu Y..  (2022)  Structural Modifications of Nimodipine Lead to Novel PDE1 Inhibitors with Anti-pulmonary Fibrosis Effects.,  65  (12.0): [PMID:35666471] [10.1021/acs.jmedchem.2c00458]

Source