N-(furan-2-ylmethyl)-2-methyl-5-(4-(4-sulfamoylphenylamino)phthalazin-1-yl)benzenesulfonamide

ID: ALA5204534

PubChem CID: 168294802

Max Phase: Preclinical

Molecular Formula: C26H23N5O5S2

Molecular Weight: 549.63

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2nnc(Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)cc1S(=O)(=O)NCc1ccco1

Standard InChI:  InChI=1S/C26H23N5O5S2/c1-17-8-9-18(15-24(17)38(34,35)28-16-20-5-4-14-36-20)25-22-6-2-3-7-23(22)26(31-30-25)29-19-10-12-21(13-11-19)37(27,32)33/h2-15,28H,16H2,1H3,(H,29,31)(H2,27,32,33)

Standard InChI Key:  OLCQFBPAIBTCRJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    0.2401    3.3542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6520    2.6394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0648    3.3542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3655    2.2275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0790    2.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0613    2.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0613    1.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7731    0.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4857    1.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4857    2.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7720    2.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7720    3.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7731    0.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4846   -0.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4846   -1.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7680   -1.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7680   -2.3047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0545   -2.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0545   -3.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6608   -3.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -3.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0834   -3.9522    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4962   -3.2392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9088   -3.9522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0834   -4.7760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -2.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6590   -2.3048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0575   -1.0649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0575   -0.2452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1935   -1.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9088   -1.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9088   -0.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1953    0.1676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0790    3.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3655    3.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5507    4.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3508    4.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6824    4.0174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  6  2  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
 11 12  1  0
 13  8  1  0
 14 13  1  0
 15 14  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  2  0
 22 25  1  0
 21 26  2  0
 26 27  1  0
 27 18  2  0
 16 28  2  0
 28 29  1  0
 29 13  2  0
 30 15  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 14 33  1  0
  5 34  1  0
 35 34  2  0
 35 36  1  0
 36 37  2  0
 38 37  1  0
 34 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5204534

    ---

Associated Targets(Human)

ENPP3 Tchem Ectonucleotide pyrophosphatase/phosphodiesterase family member 3 (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 549.63Molecular Weight (Monoisotopic): 549.1141AlogP: 4.07#Rotatable Bonds: 8
Polar Surface Area: 157.28Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.07CX Basic pKa: 2.97CX LogP: 3.57CX LogD: 3.57
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.80

References

1. Lee SY, Namasivayam V, Boshta NM, Perotti A, Mirza S, Bua S, Supuran CT, Müller CE..  (2021)  Discovery of potent nucleotide pyrophosphatase/phosphodiesterase3 (NPP3) inhibitors with ancillary carbonic anhydrase inhibition for cancer (immuno)therapy.,  12  (7.0): [PMID:34355184] [10.1039/D1MD00117E]
2. Ahmad, Haseen and 7 more authors.  2020-12-15  Synthesis of biphenyl oxazole derivatives via Suzuki coupling and biological evaluations as nucleotide pyrophosphatase/phosphodiesterase-1 and -3 inhibitors.  [PMID:32883636]

Source