The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(furan-2-ylmethyl)-2-methyl-5-(4-(4-sulfamoylphenylamino)phthalazin-1-yl)benzenesulfonamide ID: ALA5204534
PubChem CID: 168294802
Max Phase: Preclinical
Molecular Formula: C26H23N5O5S2
Molecular Weight: 549.63
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2nnc(Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)cc1S(=O)(=O)NCc1ccco1
Standard InChI: InChI=1S/C26H23N5O5S2/c1-17-8-9-18(15-24(17)38(34,35)28-16-20-5-4-14-36-20)25-22-6-2-3-7-23(22)26(31-30-25)29-19-10-12-21(13-11-19)37(27,32)33/h2-15,28H,16H2,1H3,(H,29,31)(H2,27,32,33)
Standard InChI Key: OLCQFBPAIBTCRJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
0.2401 3.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6520 2.6394 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0648 3.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3655 2.2275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0790 2.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0613 2.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0613 1.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7731 0.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4857 1.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4857 2.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7720 2.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7720 3.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7731 0.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4846 -0.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4846 -1.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7680 -1.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7680 -2.3047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0545 -2.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0545 -3.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6608 -3.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3699 -3.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0834 -3.9522 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.4962 -3.2392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9088 -3.9522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0834 -4.7760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3699 -2.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6590 -2.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0575 -1.0649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0575 -0.2452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1935 -1.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9088 -1.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9088 -0.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1953 0.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0790 3.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3655 3.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5507 4.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3508 4.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6824 4.0174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 2 0
2 4 1 0
4 5 1 0
6 2 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
11 12 1 0
13 8 1 0
14 13 1 0
15 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 2 0
22 25 1 0
21 26 2 0
26 27 1 0
27 18 2 0
16 28 2 0
28 29 1 0
29 13 2 0
30 15 1 0
31 30 2 0
32 31 1 0
33 32 2 0
14 33 1 0
5 34 1 0
35 34 2 0
35 36 1 0
36 37 2 0
38 37 1 0
34 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.63Molecular Weight (Monoisotopic): 549.1141AlogP: 4.07#Rotatable Bonds: 8Polar Surface Area: 157.28Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.07CX Basic pKa: 2.97CX LogP: 3.57CX LogD: 3.57Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.80
References 1. Lee SY, Namasivayam V, Boshta NM, Perotti A, Mirza S, Bua S, Supuran CT, Müller CE.. (2021) Discovery of potent nucleotide pyrophosphatase/phosphodiesterase3 (NPP3) inhibitors with ancillary carbonic anhydrase inhibition for cancer (immuno)therapy., 12 (7.0): [PMID:34355184 ] [10.1039/D1MD00117E ] 2. Ahmad, Haseen and 7 more authors. 2020-12-15 Synthesis of biphenyl oxazole derivatives via Suzuki coupling and biological evaluations as nucleotide pyrophosphatase/phosphodiesterase-1 and -3 inhibitors. [PMID:32883636 ]