The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((S)-3-(5-(aminomethyl)-6-oxo-1,6-dihydropyridin-3-yl)-4,4-difluoropiperidin-1-yl)-N-(5-phenoxypyridin-2-yl)propanamide ID: ALA5204738
PubChem CID: 168294502
Max Phase: Preclinical
Molecular Formula: C25H27F2N5O3
Molecular Weight: 483.52
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)Nc1ccc(Oc2ccccc2)cn1)N1CCC(F)(F)[C@@H](c2c[nH]c(=O)c(CN)c2)C1
Standard InChI: InChI=1S/C25H27F2N5O3/c1-16(23(33)31-22-8-7-20(14-29-22)35-19-5-3-2-4-6-19)32-10-9-25(26,27)21(15-32)18-11-17(12-28)24(34)30-13-18/h2-8,11,13-14,16,21H,9-10,12,15,28H2,1H3,(H,30,34)(H,29,31,33)/t16?,21-/m1/s1
Standard InChI Key: XCBDHDDHNHUKQZ-CAWMZFRYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
2.1529 -0.6553 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4407 -1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1575 -1.4803 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6572 4.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4800 4.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8942 3.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4867 3.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6608 3.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2503 3.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9016 2.5087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4917 1.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9116 1.0826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5024 0.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6769 0.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2623 1.0819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6738 1.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2662 -0.3507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4415 -0.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0307 -1.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2061 -1.0693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4446 -1.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0277 0.3606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2045 -1.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2076 -0.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0323 -0.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0292 -1.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4399 -2.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0244 -3.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4344 -3.9281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2600 -3.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6736 -3.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2611 -2.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6717 -4.6448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4983 -3.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9116 -3.9245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
18 22 2 0
20 23 1 0
20 24 1 0
24 25 1 0
25 2 1 0
23 26 1 0
26 2 1 0
26 27 1 1
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 2 0
31 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.52Molecular Weight (Monoisotopic): 483.2082AlogP: 3.47#Rotatable Bonds: 7Polar Surface Area: 113.34Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.88CX Basic pKa: 8.54CX LogP: 1.91CX LogD: 0.68Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -0.82