1-[(2R)-2-[4-(Cyclobutylmethoxy)phenyl]-2-[(2S)-2-phenylpropanamido]ethyl]-1H-1,2,3-triazole-4-carboxamide

ID: ALA5204827

PubChem CID: 168296691

Max Phase: Preclinical

Molecular Formula: C25H29N5O3

Molecular Weight: 447.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](C(=O)N[C@@H](Cn1cc(C(N)=O)nn1)c1ccc(OCC2CCC2)cc1)c1ccccc1

Standard InChI:  InChI=1S/C25H29N5O3/c1-17(19-8-3-2-4-9-19)25(32)27-22(14-30-15-23(24(26)31)28-29-30)20-10-12-21(13-11-20)33-16-18-6-5-7-18/h2-4,8-13,15,17-18,22H,5-7,14,16H2,1H3,(H2,26,31)(H,27,32)/t17-,22-/m0/s1

Standard InChI Key:  YLZYDCZLQQDIMX-JTSKRJEESA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   17.9850  -20.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9839  -21.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6961  -22.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4099  -21.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4070  -20.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6943  -20.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1173  -20.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8266  -20.9367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5369  -20.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2502  -20.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5338  -19.7041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2533  -21.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9605  -20.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6699  -20.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3797  -20.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3771  -19.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6587  -19.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9518  -19.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2717  -22.1815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1142  -19.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4009  -19.2994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3122  -18.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5081  -18.3193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0980  -19.0327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6513  -19.6420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5602  -21.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8481  -22.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0565  -21.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8444  -22.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6377  -22.9699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1732  -17.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6513  -16.9111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3602  -17.4912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  6
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 19  1  0
  7 20  1  6
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 27  1  0
 23 31  1  0
 31 32  2  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5204827

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2270AlogP: 3.22#Rotatable Bonds: 10
Polar Surface Area: 112.13Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.48CX Basic pKa: CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.23

References

1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C..  (2021)  Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies.,  64  (16.0): [PMID:34387471] [10.1021/acs.jmedchem.1c01075]

Source