The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3,5-bis(trifluoromethyl)phenylamino)-4-((S)-(6-methoxyquinolin-4-yl)((2S,4S,8R)-8-vinylquinuclidin-2-yl)methylamino)cyclobut-3-ene-1,2-dione ID: ALA5204885
Cas Number: 1256245-84-7
PubChem CID: 50918013
Product Number: B281708, Order Now?
Max Phase: Preclinical
Molecular Formula: C32H28F6N4O3
Molecular Weight: 630.59
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](Nc1c(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=O)c1=O)c1ccnc2ccc(OC)cc12
Standard InChI: InChI=1S/C32H28F6N4O3/c1-3-16-15-42-9-7-17(16)10-25(42)26(22-6-8-39-24-5-4-21(45-2)14-23(22)24)41-28-27(29(43)30(28)44)40-20-12-18(31(33,34)35)11-19(13-20)32(36,37)38/h3-6,8,11-14,16-17,25-26,40-41H,1,7,9-10,15H2,2H3/t16-,17-,25-,26-/m0/s1
Standard InChI Key: RWVDHFLTDHDJKH-FRSFCCSCSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
2.8642 0.1401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0678 -0.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4099 -0.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4176 -1.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7597 -1.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7635 -2.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4215 -2.7452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0794 -2.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0794 -1.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7521 -0.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0678 0.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8296 0.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4413 0.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4951 -0.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1602 1.2173 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9681 1.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1143 1.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9450 2.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2717 2.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2602 -0.8062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7407 -1.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4039 -1.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4056 -2.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7454 -2.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0621 -1.2202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0621 -0.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0934 -0.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1073 -1.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8415 -1.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6405 -0.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0206 0.3972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7807 0.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1610 -0.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9187 -0.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2989 0.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9220 1.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1624 1.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4997 -1.3875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2726 -1.8632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3021 1.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0621 1.7122 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9220 2.3705 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6821 2.3705 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.2988 -0.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9187 -1.5767 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.0589 -0.9184 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6789 -1.5767 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
7 8 1 0
8 9 2 0
9 4 1 0
3 10 1 6
11 2 1 0
12 11 1 0
12 13 1 0
14 1 1 0
13 14 1 0
12 15 1 6
16 12 1 0
17 1 1 0
16 17 1 0
16 18 1 1
19 18 2 0
2 20 1 1
9 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
8 24 1 0
22 25 1 0
25 26 1 0
10 27 1 0
28 27 1 0
29 28 1 0
29 30 1 0
30 27 2 0
30 31 1 0
31 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
29 38 2 0
28 39 2 0
36 40 1 0
40 41 1 0
40 42 1 0
40 43 1 0
34 44 1 0
44 45 1 0
44 46 1 0
44 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.59Molecular Weight (Monoisotopic): 630.2066AlogP: 6.67#Rotatable Bonds: 8Polar Surface Area: 83.56Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.36CX Basic pKa: 7.39CX LogP: 5.78CX LogD: 5.48Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.13Np Likeness Score: -0.17
References 1. Pósa SP, Dargó G, Nagy S, Kisszékelyi P, Garádi Z, Hámori L, Szakács G, Kupai J, Tóth S.. (2022) Cytotoxicity of cinchona alkaloid organocatalysts against MES-SA and MES-SA/Dx5 multidrug-resistant uterine sarcoma cell lines., 67 [PMID:35640378 ] [10.1016/j.bmc.2022.116855 ]