N-(2,3-bis((4-bromophenyl)amino)-7-chloroquinoxalin-6-yl)methanesulfonamide

ID: ALA5204930

PubChem CID: 168295325

Max Phase: Preclinical

Molecular Formula: C21H16Br2ClN5O2S

Molecular Weight: 597.72

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)Nc1cc2nc(Nc3ccc(Br)cc3)c(Nc3ccc(Br)cc3)nc2cc1Cl

Standard InChI:  InChI=1S/C21H16Br2ClN5O2S/c1-32(30,31)29-17-11-19-18(10-16(17)24)27-20(25-14-6-2-12(22)3-7-14)21(28-19)26-15-8-4-13(23)5-9-15/h2-11,29H,1H3,(H,25,27)(H,26,28)

Standard InChI Key:  MRKZUJQDLZOUDU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.4883   -0.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7737   -0.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0618   -0.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0618   -1.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7719   -1.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4883   -1.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3441   -1.6983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3675   -1.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3657   -0.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3491   -0.0480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0739   -0.0503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0739    0.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3629    1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3635    2.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0749    2.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7832    2.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7880    1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0826   -1.6921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7897   -1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861   -0.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4899   -0.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1993   -0.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2048   -1.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5021   -1.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1993   -0.0489    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9105   -0.0439    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.0749    3.2319    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -3.1993   -1.6984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1993   -2.5195    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9105   -2.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7881   -3.2319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3783   -2.5195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  3 10  1  0
  9 11  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
  8 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 19 24  2  0
  1 25  1  0
 22 26  1  0
 15 27  1  0
  6 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 29 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5204930

    ---

Associated Targets(non-human)

SUB1 Subtilisin-like protease (110 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 597.72Molecular Weight (Monoisotopic): 594.9080AlogP: 6.67#Rotatable Bonds: 6
Polar Surface Area: 96.01Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.96CX Basic pKa: 2.04CX LogP: 5.88CX LogD: 5.87
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.23Np Likeness Score: -1.33

References

1. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A..  (2022)  Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery.,  65  (19.0): [PMID:36137276] [10.1021/acs.jmedchem.2c01093]

Source