The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-N-[(1R)-1-[4-(Cyclobutylmethoxy)phenyl]-2-(4-ethoxy-1H-1,2,3-triazol-1-yl)ethyl]-2-phenylpropanamide ID: ALA5205098
PubChem CID: 168294517
Max Phase: Preclinical
Molecular Formula: C26H32N4O3
Molecular Weight: 448.57
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cn(C[C@H](NC(=O)[C@@H](C)c2ccccc2)c2ccc(OCC3CCC3)cc2)nn1
Standard InChI: InChI=1S/C26H32N4O3/c1-3-32-25-17-30(29-28-25)16-24(27-26(31)19(2)21-10-5-4-6-11-21)22-12-14-23(15-13-22)33-18-20-8-7-9-20/h4-6,10-15,17,19-20,24H,3,7-9,16,18H2,1-2H3,(H,27,31)/t19-,24-/m0/s1
Standard InChI Key: QPGSHJJVSZCMRX-CYFREDJKSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.9360 -13.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9348 -14.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6470 -15.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3608 -14.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3579 -13.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6452 -13.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0682 -13.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7775 -13.9246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4878 -13.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2011 -13.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4847 -12.6920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2042 -14.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9114 -13.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6208 -13.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3306 -13.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3280 -12.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6096 -12.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9027 -12.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2227 -15.1693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0652 -12.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3518 -12.2873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2631 -11.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4590 -11.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0489 -12.0206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6022 -12.6298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5111 -14.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7990 -15.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0074 -14.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7953 -15.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5886 -15.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1241 -10.5617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6022 -9.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2674 -9.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 6
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 19 1 0
7 20 1 6
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 21 1 0
19 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 27 1 0
23 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.57Molecular Weight (Monoisotopic): 448.2474AlogP: 4.52#Rotatable Bonds: 11Polar Surface Area: 78.27Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.99CX Basic pKa: ┄CX LogP: 5.06CX LogD: 5.06Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.13
References 1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C.. (2021) Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies., 64 (16.0): [PMID:34387471 ] [10.1021/acs.jmedchem.1c01075 ]