(2S)-N-[(1R)-1-[4-(Cyclobutylmethoxy)phenyl]-2-(4-ethoxy-1H-1,2,3-triazol-1-yl)ethyl]-2-phenylpropanamide

ID: ALA5205098

PubChem CID: 168294517

Max Phase: Preclinical

Molecular Formula: C26H32N4O3

Molecular Weight: 448.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cn(C[C@H](NC(=O)[C@@H](C)c2ccccc2)c2ccc(OCC3CCC3)cc2)nn1

Standard InChI:  InChI=1S/C26H32N4O3/c1-3-32-25-17-30(29-28-25)16-24(27-26(31)19(2)21-10-5-4-6-11-21)22-12-14-23(15-13-22)33-18-20-8-7-9-20/h4-6,10-15,17,19-20,24H,3,7-9,16,18H2,1-2H3,(H,27,31)/t19-,24-/m0/s1

Standard InChI Key:  QPGSHJJVSZCMRX-CYFREDJKSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    3.9360  -13.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9348  -14.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6470  -15.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3608  -14.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3579  -13.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6452  -13.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0682  -13.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7775  -13.9246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4878  -13.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2011  -13.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4847  -12.6920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2042  -14.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9114  -13.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6208  -13.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3306  -13.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3280  -12.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6096  -12.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9027  -12.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2227  -15.1693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0652  -12.6973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3518  -12.2873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2631  -11.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4590  -11.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0489  -12.0206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6022  -12.6298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5111  -14.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7990  -15.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0074  -14.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7953  -15.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5886  -15.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1241  -10.5617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6022   -9.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2674   -9.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  6
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 19  1  0
  7 20  1  6
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 27  1  0
 23 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5205098

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.57Molecular Weight (Monoisotopic): 448.2474AlogP: 4.52#Rotatable Bonds: 11
Polar Surface Area: 78.27Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.99CX Basic pKa: CX LogP: 5.06CX LogD: 5.06
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.13

References

1. Rahman MT, Decker AM, Laudermilk L, Maitra R, Ma W, Ben Hamida S, Darcq E, Kieffer BL, Jin C..  (2021)  Evaluation of Amide Bioisosteres Leading to 1,2,3-Triazole Containing Compounds as GPR88 Agonists: Design, Synthesis, and Structure-Activity Relationship Studies.,  64  (16.0): [PMID:34387471] [10.1021/acs.jmedchem.1c01075]

Source