The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-dioxo-2-(4-sulfamoylbenzamido)isoindoline-5-carboxylic acid ID: ALA5205140
PubChem CID: 168295333
Max Phase: Preclinical
Molecular Formula: C16H11N3O7S
Molecular Weight: 389.35
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(C(=O)NN2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1
Standard InChI: InChI=1S/C16H11N3O7S/c17-27(25,26)10-4-1-8(2-5-10)13(20)18-19-14(21)11-6-3-9(16(23)24)7-12(11)15(19)22/h1-7H,(H,18,20)(H,23,24)(H2,17,25,26)
Standard InChI Key: CHTDZQLORQKFFG-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-3.2588 0.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5442 0.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8322 0.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8322 -0.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5424 -0.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2588 -0.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0475 -0.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0475 0.5748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5625 -0.0927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8339 1.3718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8339 -1.5572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2626 -0.0927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6752 0.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5003 0.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2626 1.3365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9132 1.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7359 1.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1486 0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7395 -0.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9147 -0.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9738 0.6208 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3864 1.3354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9738 -0.2058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6880 0.2074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9733 0.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9733 1.5572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6880 0.3195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
3 8 1 0
8 9 1 0
9 7 1 0
8 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
16 14 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
14 20 1 0
18 21 1 0
21 22 1 0
21 23 2 0
21 24 2 0
25 1 1 0
25 26 1 0
25 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.35Molecular Weight (Monoisotopic): 389.0318AlogP: -0.03#Rotatable Bonds: 4Polar Surface Area: 163.94Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.51CX Basic pKa: ┄CX LogP: 0.22CX LogD: -3.19Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.62Np Likeness Score: -1.17