1,3-dioxo-2-(4-sulfamoylbenzamido)isoindoline-5-carboxylic acid

ID: ALA5205140

PubChem CID: 168295333

Max Phase: Preclinical

Molecular Formula: C16H11N3O7S

Molecular Weight: 389.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(C(=O)NN2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1

Standard InChI:  InChI=1S/C16H11N3O7S/c17-27(25,26)10-4-1-8(2-5-10)13(20)18-19-14(21)11-6-3-9(16(23)24)7-12(11)15(19)22/h1-7H,(H,18,20)(H,23,24)(H2,17,25,26)

Standard InChI Key:  CHTDZQLORQKFFG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   -3.2588    0.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5442    0.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8322    0.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8322   -0.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5424   -0.9170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2588   -0.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0475   -0.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0475    0.5748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5625   -0.0927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8339    1.3718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8339   -1.5572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2626   -0.0927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6752    0.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5003    0.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2626    1.3365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9132    1.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7359    1.3355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1486    0.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7395   -0.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9147   -0.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9738    0.6208    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.3864    1.3354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9738   -0.2058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6880    0.2074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9733    0.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9733    1.5572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6880    0.3195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  1  0
  9  7  1  0
  8 10  2  0
  7 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 16 14  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 14 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 21 24  2  0
 25  1  1  0
 25 26  1  0
 25 27  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5205140

    ---

Associated Targets(Human)

CA4 Tclin Carbonic anhydrase IV (2163 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA9 Tclin Carbonic anhydrase IX (8255 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.35Molecular Weight (Monoisotopic): 389.0318AlogP: -0.03#Rotatable Bonds: 4
Polar Surface Area: 163.94Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 3.51CX Basic pKa: CX LogP: 0.22CX LogD: -3.19
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.62Np Likeness Score: -1.17

References

1. Kumar S, Rulhania S, Jaswal S, Monga V..  (2021)  Recent advances in the medicinal chemistry of carbonic anhydrase inhibitors.,  209  [PMID:33121862] [10.1016/j.ejmech.2020.112923]

Source