The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((6-bromo-4-oxo-2-thioxo-1,2-dihydroquinazolin-3(4H)-yl)methyl)-N-(4-sulfamoylphenethyl)benzamide ID: ALA520525
PubChem CID: 4650258
Max Phase: Preclinical
Molecular Formula: C24H21BrN4O4S2
Molecular Weight: 573.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(Cn3c(=S)[nH]c4ccc(Br)cc4c3=O)cc2)cc1
Standard InChI: InChI=1S/C24H21BrN4O4S2/c25-18-7-10-21-20(13-18)23(31)29(24(34)28-21)14-16-1-5-17(6-2-16)22(30)27-12-11-15-3-8-19(9-4-15)35(26,32)33/h1-10,13H,11-12,14H2,(H,27,30)(H,28,34)(H2,26,32,33)
Standard InChI Key: KUYFJJROJAVPPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
11.8417 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8417 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5537 -2.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5537 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2657 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2622 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9710 -2.2049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6878 -1.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6913 -0.9727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9780 -0.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9803 0.2701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3999 -2.2142 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.1260 -0.5563 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.4079 -0.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1202 -0.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1137 -1.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8252 -2.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5428 -1.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5445 -0.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8324 -0.5709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2556 -2.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2524 -3.0529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9717 -1.8182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9750 -0.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6910 -0.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6943 0.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4138 0.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4174 1.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7040 1.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9855 1.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9855 0.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7062 2.7123 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.7000 3.5375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5312 2.7143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8812 2.7100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
5 10 1 0
17 18 2 0
6 7 1 0
18 19 1 0
7 8 1 0
19 20 2 0
20 15 1 0
8 9 1 0
18 21 1 0
9 10 1 0
21 22 2 0
5 6 2 0
21 23 1 0
10 11 2 0
23 24 1 0
24 25 1 0
8 12 2 0
25 26 1 0
1 2 1 0
26 27 2 0
1 13 1 0
27 28 1 0
1 4 2 0
28 29 2 0
9 14 1 0
29 30 1 0
2 3 2 0
30 31 2 0
31 26 1 0
14 15 1 0
29 32 1 0
3 6 1 0
32 33 1 0
15 16 2 0
32 34 2 0
5 4 1 0
32 35 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.49Molecular Weight (Monoisotopic): 572.0188AlogP: 3.49#Rotatable Bonds: 7Polar Surface Area: 127.05Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.98CX Basic pKa: ┄CX LogP: 4.70CX LogD: 4.19Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -1.47
References 1. Yu WM, Guvench O, Mackerell AD, Qu CK.. (2008) Identification of small molecular weight inhibitors of Src homology 2 domain-containing tyrosine phosphatase 2 (SHP-2) via in silico database screening combined with experimental assay., 51 (23): [PMID:19007293 ] [10.1021/jm800229d ]