Methyl (3S)-1-(1-(4-(trifluoromethyl)benzyl)-3-oxo-1,3-dihydroisobenzofuran-5-yl)pyrrolidine-3-carboxylate

ID: ALA5205251

PubChem CID: 168297569

Max Phase: Preclinical

Molecular Formula: C22H20F3NO4

Molecular Weight: 419.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H]1CCN(c2ccc3c(c2)C(=O)OC3Cc2ccc(C(F)(F)F)cc2)C1

Standard InChI:  InChI=1S/C22H20F3NO4/c1-29-20(27)14-8-9-26(12-14)16-6-7-17-18(11-16)21(28)30-19(17)10-13-2-4-15(5-3-13)22(23,24)25/h2-7,11,14,19H,8-10,12H2,1H3/t14-,19?/m0/s1

Standard InChI Key:  LTJATBVCYRIZGX-KTQQKIMGSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -1.5891    0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5891   -0.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3039   -1.0679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0579   -0.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6102   -1.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4310   -1.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7665   -0.5053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9159   -1.9271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5804   -2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1974   -2.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3901   -1.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8747   -1.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1599   -0.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6247   -0.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8799   -1.6954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1099   -0.2426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6247    0.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8799    1.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6872    1.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2392    0.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0465    0.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3017    1.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1087    1.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9159    2.0675    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6610    1.2826    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.3639    2.6810    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7493    2.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9421    2.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1599    0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8747    0.5823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  6
  6  7  2  0
  6  8  1  0
  8  9  1  0
 10  5  1  0
 11 10  1  0
  3 11  1  0
  2 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 16 14  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 22 27  2  0
 27 28  1  0
 28 19  2  0
 29 17  1  0
 13 29  2  0
 29 30  1  0
 30  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5205251

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.40Molecular Weight (Monoisotopic): 419.1344AlogP: 4.16#Rotatable Bonds: 4
Polar Surface Area: 55.84Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.43CX LogP: 4.52CX LogD: 4.52
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -0.46

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source