(2E,4E)-5-(4-Hydroxyphenyl)-2-phenyl-1-(4-(pyrimidin-2-yl)piperazin-1-yl)penta-2,4-dien-1-one

ID: ALA5205411

PubChem CID: 168294236

Max Phase: Preclinical

Molecular Formula: C25H24N4O2

Molecular Weight: 412.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C(=C/C=C/c1ccc(O)cc1)c1ccccc1)N1CCN(c2ncccn2)CC1

Standard InChI:  InChI=1S/C25H24N4O2/c30-22-12-10-20(11-13-22)6-4-9-23(21-7-2-1-3-8-21)24(31)28-16-18-29(19-17-28)25-26-14-5-15-27-25/h1-15,30H,16-19H2/b6-4+,23-9+

Standard InChI Key:  CXVREUJIRPXKCH-NMSNNANNSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -2.1339   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8484   -1.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1339   -2.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8459   -2.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5580   -2.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5580   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4268   -1.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4268   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7196    0.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7196    1.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0100    1.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0100    2.2621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7019    1.0331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4172    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1330    1.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1330    0.2124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4245   -0.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7019    0.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8450   -0.1957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8450   -1.0207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5570   -1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -1.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -0.1957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5570    0.2209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4316    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4316    2.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1436    2.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8556    2.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8556    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1436    1.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2690   -2.6685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  4  3  2  0
  5  4  1  0
  2  6  1  0
  6  5  2  0
  1  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 13 18  1  0
 19 16  1  0
 20 19  2  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 19 24  1  0
 24 23  2  0
 25 10  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
  5 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5205411

    ---

Associated Targets(non-human)

HT-22 (3261 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.49Molecular Weight (Monoisotopic): 412.1899AlogP: 3.63#Rotatable Bonds: 5
Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.51CX Basic pKa: 3.20CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -0.68

References

1. Fang Y, Tan Q, Zhou H, Gu Q, Xu J..  (2022)  Discovery of novel diphenylbutene derivative ferroptosis inhibitors as neuroprotective agents.,  231  [PMID:35123296] [10.1016/j.ejmech.2022.114151]

Source