The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,4E)-5-(4-Hydroxyphenyl)-2-phenyl-1-(4-(pyrimidin-2-yl)piperazin-1-yl)penta-2,4-dien-1-one ID: ALA5205411
PubChem CID: 168294236
Max Phase: Preclinical
Molecular Formula: C25H24N4O2
Molecular Weight: 412.49
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C(=C/C=C/c1ccc(O)cc1)c1ccccc1)N1CCN(c2ncccn2)CC1
Standard InChI: InChI=1S/C25H24N4O2/c30-22-12-10-20(11-13-22)6-4-9-23(21-7-2-1-3-8-21)24(31)28-16-18-29(19-17-28)25-26-14-5-15-27-25/h1-15,30H,16-19H2/b6-4+,23-9+
Standard InChI Key: CXVREUJIRPXKCH-NMSNNANNSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-2.1339 -1.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8484 -1.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1339 -2.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8459 -2.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5580 -2.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5580 -1.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4268 -1.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4268 -0.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7196 0.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7196 1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0100 1.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0100 2.2621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7019 1.0331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4172 1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1330 1.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1330 0.2124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4245 -0.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7019 0.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 -0.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 -1.0207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5570 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2690 -1.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2690 -0.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5570 0.2209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4316 1.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4316 2.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1436 2.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8556 2.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8556 1.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1436 1.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2690 -2.6685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
4 3 2 0
5 4 1 0
2 6 1 0
6 5 2 0
1 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
11 12 2 0
13 11 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 18 1 0
19 16 1 0
20 19 2 0
20 21 1 0
22 21 2 0
23 22 1 0
19 24 1 0
24 23 2 0
25 10 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
5 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.49Molecular Weight (Monoisotopic): 412.1899AlogP: 3.63#Rotatable Bonds: 5Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.51CX Basic pKa: 3.20CX LogP: 4.16CX LogD: 4.16Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -0.68
References 1. Fang Y, Tan Q, Zhou H, Gu Q, Xu J.. (2022) Discovery of novel diphenylbutene derivative ferroptosis inhibitors as neuroprotective agents., 231 [PMID:35123296 ] [10.1016/j.ejmech.2022.114151 ]