The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5205464
PubChem CID: 168295610
Max Phase: Preclinical
Molecular Formula: C22H27N3O6
Molecular Weight: 429.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(/N=C/c3cccc([N+](=O)[O-])c3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4
Standard InChI: InChI=1S/C22H27N3O6/c1-13-7-8-18-14(2)19(26)24(23-12-15-5-4-6-16(11-15)25(27)28)20-22(18)17(13)9-10-21(3,29-20)30-31-22/h4-6,11-14,17-18,20H,7-10H2,1-3H3/b23-12+/t13-,14-,17+,18+,20-,21-,22-/m1/s1
Standard InChI Key: BLHIPXMMFKCBSY-QDKFLVBYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
0.7237 -0.4765 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4382 -0.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4419 0.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0294 1.3250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3150 0.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5100 0.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6385 0.1502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7100 1.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5207 1.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 1.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 2.0613 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8577 1.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8577 2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5720 1.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5720 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8577 -0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5721 -0.4133 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8577 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5721 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 -1.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 -2.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4382 -0.8255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -1.2380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 -2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4270 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 -2.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4316 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 -0.8276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5721 -1.2401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 -0.0027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 6
5 4 1 0
6 5 1 6
6 7 1 0
6 8 1 0
8 2 1 0
9 6 1 0
9 10 1 0
10 11 1 0
11 3 1 0
11 12 1 6
11 13 1 0
13 14 1 6
15 13 1 0
16 15 1 0
17 16 1 0
17 3 1 0
17 18 1 6
17 19 1 0
19 20 1 1
21 19 1 0
21 22 2 0
23 21 1 0
2 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
30 32 1 0
32 33 2 0
32 34 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.47Molecular Weight (Monoisotopic): 429.1900AlogP: 3.62#Rotatable Bonds: 3Polar Surface Area: 103.50Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.81CX LogP: 4.46CX LogD: 4.46Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: 0.97
References 1. Karnatak M, Hassam M, Singh AS, Yadav DK, Singh C, Puri SK, Verma VP.. (2022) Novel hydrazone derivatives of N-amino-11-azaartemisinin with high order of antimalarial activity against multidrug-resistant Plasmodium yoelii nigeriensis in Swiss mice via intramuscular route., 58 [PMID:34974111 ] [10.1016/j.bmcl.2021.128522 ]