ID: ALA5205464

PubChem CID: 168295610

Max Phase: Preclinical

Molecular Formula: C22H27N3O6

Molecular Weight: 429.47

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(/N=C/c3cccc([N+](=O)[O-])c3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4

Standard InChI:  InChI=1S/C22H27N3O6/c1-13-7-8-18-14(2)19(26)24(23-12-15-5-4-6-16(11-15)25(27)28)20-22(18)17(13)9-10-21(3,29-20)30-31-22/h4-6,11-14,17-18,20H,7-10H2,1-3H3/b23-12+/t13-,14-,17+,18+,20-,21-,22-/m1/s1

Standard InChI Key:  BLHIPXMMFKCBSY-QDKFLVBYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.7237   -0.4765    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4382   -0.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4419    0.6106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0294    1.3250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3150    0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5100    0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6385    0.1502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7100    1.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5207    1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0613    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8577    1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8577    2.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5720    1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5720    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8577   -0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5721   -0.4133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8577   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5721   -1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.0629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4382   -0.8255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147   -1.2380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0002   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7141   -1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7141   -2.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4270   -2.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1433   -2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1433   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4316   -0.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8577   -0.8276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5721   -1.2401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8577   -0.0027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  6
  5  4  1  0
  6  5  1  6
  6  7  1  0
  6  8  1  0
  8  2  1  0
  9  6  1  0
  9 10  1  0
 10 11  1  0
 11  3  1  0
 11 12  1  6
 11 13  1  0
 13 14  1  6
 15 13  1  0
 16 15  1  0
 17 16  1  0
 17  3  1  0
 17 18  1  6
 17 19  1  0
 19 20  1  1
 21 19  1  0
 21 22  2  0
 23 21  1  0
  2 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 30 32  1  0
 32 33  2  0
 32 34  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA5205464

    ---

Associated Targets(non-human)

Plasmodium yoelii nigeriensis (1119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.47Molecular Weight (Monoisotopic): 429.1900AlogP: 3.62#Rotatable Bonds: 3
Polar Surface Area: 103.50Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.81CX LogP: 4.46CX LogD: 4.46
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: 0.97

References

1. Karnatak M, Hassam M, Singh AS, Yadav DK, Singh C, Puri SK, Verma VP..  (2022)  Novel hydrazone derivatives of N-amino-11-azaartemisinin with high order of antimalarial activity against multidrug-resistant Plasmodium yoelii nigeriensis in Swiss mice via intramuscular route.,  58  [PMID:34974111] [10.1016/j.bmcl.2021.128522]

Source