(4-Aminophenyl)(3,9-diazaspiro[5.5]undecan-3-yl)methanone

ID: ALA5205502

PubChem CID: 168296725

Max Phase: Preclinical

Molecular Formula: C16H23N3O

Molecular Weight: 273.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccc(C(=O)N2CCC3(CCNCC3)CC2)cc1

Standard InChI:  InChI=1S/C16H23N3O/c17-14-3-1-13(2-4-14)15(20)19-11-7-16(8-12-19)5-9-18-10-6-16/h1-4,18H,5-12,17H2

Standard InChI Key:  YIJURGQIKYCWEG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   20.7802  -18.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4952  -18.5743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2072  -18.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2104  -17.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4955  -16.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7772  -17.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3543  -18.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3543  -18.9899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0688  -19.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7834  -18.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0688  -17.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9243  -16.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9265  -16.1006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6346  -17.3396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6329  -18.1638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3447  -18.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0587  -18.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0564  -17.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3440  -16.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7719  -18.5751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10  1  1  0
  1 11  1  0
  4 12  1  0
 12 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 12 14  1  0
 17 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5205502

    ---

Associated Targets(non-human)

Gabrp GABA-A receptor; anion channel (5731 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 273.38Molecular Weight (Monoisotopic): 273.1841AlogP: 1.87#Rotatable Bonds: 1
Polar Surface Area: 58.36Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.33CX LogP: 0.74CX LogD: -2.02
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.77Np Likeness Score: -0.68

References

1. Bavo F, de-Jong H, Petersen J, Falk-Petersen CB, Löffler R, Sparrow E, Rostrup F, Eliasen JN, Wilhelmsen KS, Barslund K, Bundgaard C, Nielsen B, Kristiansen U, Wellendorph P, Bogdanov Y, Frølund B..  (2021)  Structure-Activity Studies of 3,9-Diazaspiro[5.5]undecane-Based γ-Aminobutyric Acid Type A Receptor Antagonists with Immunomodulatory Effect.,  64  (24.0): [PMID:34908407] [10.1021/acs.jmedchem.1c00290]

Source