The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-4,4-difluoro-3-(5-(methylsulfonylmethyl)-6-oxo-1,6-dihydropyridin-3-yl)piperidin-1-yl)-N-(5-(2,4-difluorophenoxy)pyridin-2-yl)propanamide ID: ALA5205680
PubChem CID: 163238057
Max Phase: Preclinical
Molecular Formula: C26H26F4N4O5S
Molecular Weight: 582.58
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](C(=O)Nc1ccc(Oc2ccc(F)cc2F)cn1)N1CCC(F)(F)[C@@H](c2c[nH]c(=O)c(CS(C)(=O)=O)c2)C1
Standard InChI: InChI=1S/C26H26F4N4O5S/c1-15(24(35)33-23-6-4-19(12-31-23)39-22-5-3-18(27)10-21(22)28)34-8-7-26(29,30)20(13-34)16-9-17(14-40(2,37)38)25(36)32-11-16/h3-6,9-12,15,20H,7-8,13-14H2,1-2H3,(H,32,36)(H,31,33,35)/t15-,20+/m0/s1
Standard InChI Key: XVYUTJXUHASOSR-MGPUTAFESA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
2.7736 -2.4328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4887 -2.8443 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4876 -2.0193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7385 -1.0069 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0276 -1.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7431 -1.8304 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.0630 4.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8843 4.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2978 3.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8910 2.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0665 2.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6568 3.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3050 2.1514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8960 1.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3151 0.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9066 0.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0826 0.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6688 0.7271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0795 1.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6726 -0.7029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8495 -0.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4395 -1.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6163 -1.4202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8526 -2.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4364 0.0072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2063 -2.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2032 -0.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6198 -0.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 -2.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0268 -2.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6119 -3.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0213 -4.2738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8453 -4.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2582 -3.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8465 -2.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2563 -4.9892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0813 -3.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6480 4.9892 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6559 2.1481 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3151 -2.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 1
21 25 2 0
23 26 1 0
23 27 1 0
27 28 1 0
28 5 1 0
26 29 1 0
29 5 1 0
29 30 1 1
30 31 2 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 2 0
34 37 1 0
37 2 1 0
7 38 1 0
11 39 1 0
2 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.58Molecular Weight (Monoisotopic): 582.1560AlogP: 3.84#Rotatable Bonds: 8Polar Surface Area: 121.46Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.55CX Basic pKa: 5.18CX LogP: 1.67CX LogD: 1.67Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.39Np Likeness Score: -1.21