(S)-2-((S)-4,4-difluoro-3-(5-(methylsulfonylmethyl)-6-oxo-1,6-dihydropyridin-3-yl)piperidin-1-yl)-N-(5-(2,4-difluorophenoxy)pyridin-2-yl)propanamide

ID: ALA5205680

PubChem CID: 163238057

Max Phase: Preclinical

Molecular Formula: C26H26F4N4O5S

Molecular Weight: 582.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](C(=O)Nc1ccc(Oc2ccc(F)cc2F)cn1)N1CCC(F)(F)[C@@H](c2c[nH]c(=O)c(CS(C)(=O)=O)c2)C1

Standard InChI:  InChI=1S/C26H26F4N4O5S/c1-15(24(35)33-23-6-4-19(12-31-23)39-22-5-3-18(27)10-21(22)28)34-8-7-26(29,30)20(13-34)16-9-17(14-40(2,37)38)25(36)32-11-16/h3-6,9-12,15,20H,7-8,13-14H2,1-2H3,(H,32,36)(H,31,33,35)/t15-,20+/m0/s1

Standard InChI Key:  XVYUTJXUHASOSR-MGPUTAFESA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    2.7736   -2.4328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4887   -2.8443    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4876   -2.0193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7385   -1.0069    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0276   -1.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7431   -1.8304    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0630    4.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8843    4.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2978    3.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8910    2.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0665    2.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6568    3.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3050    2.1514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8960    1.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3151    0.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9066    0.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0826    0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6688    0.7271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0795    1.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6726   -0.7029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8495   -0.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4395   -1.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6163   -1.4202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8526   -2.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4364    0.0072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2063   -2.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2032   -0.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6198   -0.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6167   -2.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0268   -2.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6119   -3.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0213   -4.2738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8453   -4.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2582   -3.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8465   -2.8487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2563   -4.9892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0813   -3.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6480    4.9892    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6559    2.1481    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.3151   -2.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  1
 21 25  2  0
 23 26  1  0
 23 27  1  0
 27 28  1  0
 28  5  1  0
 26 29  1  0
 29  5  1  0
 29 30  1  1
 30 31  2  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  2  0
 34 37  1  0
 37  2  1  0
  7 38  1  0
 11 39  1  0
  2 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5205680

    ---

Associated Targets(Human)

MRGPRX2 Tchem Mas-related G-protein coupled receptor member X2 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 582.58Molecular Weight (Monoisotopic): 582.1560AlogP: 3.84#Rotatable Bonds: 8
Polar Surface Area: 121.46Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.55CX Basic pKa: 5.18CX LogP: 1.67CX LogD: 1.67
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.39Np Likeness Score: -1.21

References

1. Sabnis RW..  (2022)  Novel MRGX2 Antagonists for Treating Diseases.,  13  (7.0): [PMID:35928854] [10.1021/acsmedchemlett.2c00262]

Source