5-([1,4'-bipiperidin]-1'-yl)-2-(4-methoxybenzamido)benzoic acid

ID: ALA5205971

PubChem CID: 50782786

Max Phase: Preclinical

Molecular Formula: C25H31N3O4

Molecular Weight: 437.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)Nc2ccc(N3CCC(N4CCCCC4)CC3)cc2C(=O)O)cc1

Standard InChI:  InChI=1S/C25H31N3O4/c1-32-21-8-5-18(6-9-21)24(29)26-23-10-7-20(17-22(23)25(30)31)28-15-11-19(12-16-28)27-13-3-2-4-14-27/h5-10,17,19H,2-4,11-16H2,1H3,(H,26,29)(H,30,31)

Standard InChI Key:  VDXUEJYFPGPSBC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.6750   -0.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0917   -1.2492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2949   -1.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1616   -0.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3926    0.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7538   -0.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8876   -1.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6605   -1.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9822   -0.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7687    0.6366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3436   -0.6826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5719   -0.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4388    0.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3301    0.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9689    0.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8352   -0.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0622   -0.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1511   -1.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4321   -2.2921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9481   -1.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7406    0.4845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8738    1.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6458    1.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2844    1.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1511    0.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3793   -0.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0813    1.2818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2948    2.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0917    2.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6750    1.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4615    0.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6647    0.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9  6  1  0
  9 10  2  0
 11  9  1  0
 12 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 15 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 25 26  1  0
 26 21  1  0
 27 24  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 27 32  1  0
M  END

Associated Targets(non-human)

CHO-K1 (1115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.54Molecular Weight (Monoisotopic): 437.2315AlogP: 4.10#Rotatable Bonds: 6
Polar Surface Area: 82.11Molecular Species: ZWITTERIONHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.29CX Basic pKa: 9.92CX LogP: 1.47CX LogD: 1.47
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -1.12

References

1. Dobrovolskaite A, Moots H, Tantak MP, Shah K, Thomas J, Dinara S, Massaro C, Hershberger PM, Maloney PR, Peddibhotla S, Sugarman E, Litherland S, Arnoletti JP, Jha RK, Levens D, Phanstiel O..  (2022)  Discovery of Anthranilic Acid Derivatives as Difluoromethylornithine Adjunct Agents That Inhibit Far Upstream Element Binding Protein 1 (FUBP1) Function.,  65  (22.0): [PMID:36382923] [10.1021/acs.jmedchem.2c01350]

Source