The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sodium 4-(((1-(4-(benzylamino)-4-oxobutyl)-1H-tetrazol-5-yl)(cyclopropyl)methyl)amino)-3-hydroxybutanoate ID: ALA5206020
PubChem CID: 168296747
Max Phase: Preclinical
Molecular Formula: C20H27N6NaO4
Molecular Weight: 416.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C([O-])CC(O)CNC(c1nnnn1CCCC(=O)NCc1ccccc1)C1CC1.[Na+]
Standard InChI: InChI=1S/C20H28N6O4.Na/c27-16(11-18(29)30)13-22-19(15-8-9-15)20-23-24-25-26(20)10-4-7-17(28)21-12-14-5-2-1-3-6-14;/h1-3,5-6,15-16,19,22,27H,4,7-13H2,(H,21,28)(H,29,30);/q;+1/p-1
Standard InChI Key: IOZYVGILZUUOKO-UHFFFAOYSA-M
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
-3.8676 -1.3548 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
0.8189 2.2666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1515 2.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4064 3.5362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2315 3.5362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4863 2.7515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6455 2.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8590 1.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6561 1.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8697 0.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6667 0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8803 -0.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6773 -0.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2968 -0.8638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2862 0.1467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2289 3.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4429 3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0258 3.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8189 1.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5335 1.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5335 0.2036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2482 -0.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2482 -1.0340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9628 -1.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9628 -2.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9628 0.2036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6773 -2.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6765 -3.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9617 -3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2498 -3.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2450 -2.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 2 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
10 15 1 0
16 7 1 0
16 17 1 0
17 18 1 0
16 18 1 0
2 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 23 1 0
25 24 1 0
22 26 2 0
27 25 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
25 31 1 0
M CHG 2 1 1 13 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.48Molecular Weight (Monoisotopic): 416.2172AlogP: 0.65#Rotatable Bonds: 13Polar Surface Area: 142.26Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.83CX Basic pKa: 7.64CX LogP: -2.26CX LogD: -2.43Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -1.22
References 1. Ulgheri F, Spanu P, Deligia F, Loriga G, Fuggetta MP, de Haan I, Chandgudge A, Groves M, Domling A.. (2022) Design, synthesis and biological evaluation of 1,5-disubstituted α-amino tetrazole derivatives as non-covalent inflammasome-caspase-1 complex inhibitors with potential application against immune and inflammatory disorders., 229 [PMID:34823899 ] [10.1016/j.ejmech.2021.114002 ]