N-((3R)-1-(1-(3,4-difluorobenzyl)-3-oxo-1,3-dihydroisobenzofuran-5-yl)pyrrolidin-3-yl)acetamide

ID: ALA5206103

PubChem CID: 168294566

Max Phase: Preclinical

Molecular Formula: C21H20F2N2O3

Molecular Weight: 386.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H]1CCN(c2ccc3c(c2)C(=O)OC3Cc2ccc(F)c(F)c2)C1

Standard InChI:  InChI=1S/C21H20F2N2O3/c1-12(26)24-14-6-7-25(11-14)15-3-4-16-17(10-15)21(27)28-20(16)9-13-2-5-18(22)19(23)8-13/h2-5,8,10,14,20H,6-7,9,11H2,1H3,(H,24,26)/t14-,20?/m1/s1

Standard InChI Key:  WKQWXLIWWUHHIJ-QMRFKDRMSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -0.7751   -0.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7751   -0.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4896   -1.2884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2433   -0.9528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7953   -1.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6158   -1.4797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1007   -2.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7652   -2.9008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9212   -2.0609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3828   -2.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5758   -2.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0607   -1.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6537   -0.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4383   -1.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6933   -1.9155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9232   -0.4634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4383    0.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6933    0.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5003    1.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0523    0.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8593    0.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1142    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9212    1.6747    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5621    2.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8171    2.9008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7552    1.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6537   -0.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0607    0.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  1
  6  7  1  0
  7  8  2  0
  7  9  1  0
 10  5  1  0
 11 10  1  0
  3 11  1  0
  2 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 16 14  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 24 26  1  0
 26 19  2  0
 27 17  1  0
 13 27  2  0
 27 28  1  0
 28  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5206103

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.40Molecular Weight (Monoisotopic): 386.1442AlogP: 3.13#Rotatable Bonds: 4
Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: 2.37CX LogP: 2.96CX LogD: 2.96
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: -0.77

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source