The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[(2,6-Difluoro-3,5-dimethoxyphenyl)methoxy]-N-{3-fluoro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl}pyrimidin-2-amine ID: ALA5206147
PubChem CID: 129180276
Max Phase: Preclinical
Molecular Formula: C29H35F3N6O3
Molecular Weight: 572.63
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(F)c(COc2cnc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)c(F)c3)nc2)c1F
Standard InChI: InChI=1S/C29H35F3N6O3/c1-36-10-12-37(13-11-36)20-6-8-38(9-7-20)24-5-4-19(14-23(24)30)35-29-33-16-21(17-34-29)41-18-22-27(31)25(39-2)15-26(40-3)28(22)32/h4-5,14-17,20H,6-13,18H2,1-3H3,(H,33,34,35)
Standard InChI Key: UEJDKYLMUXYNLX-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-2.5002 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7857 -0.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0738 -0.8236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0738 -1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7839 -2.0606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 -1.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3591 -2.0614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3554 -1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3556 -0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0685 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7833 -0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7849 -1.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0731 -2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4980 -0.4130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4979 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9273 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9273 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 -0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6418 0.8246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6418 1.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3565 2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0711 1.6498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0712 0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3565 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7857 2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 -0.4114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6441 -0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3590 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0711 -0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0711 0.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3608 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6441 0.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 0.8298 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.3608 1.6506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.0754 2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7857 -0.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7857 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3590 -1.6490 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4995 -2.0593 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
14 11 1 0
14 15 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
14 19 1 0
20 17 1 0
20 21 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
20 25 1 0
23 26 1 0
1 27 1 0
27 28 1 0
28 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
34 35 1 0
33 36 1 0
36 37 1 0
31 38 1 0
38 39 1 0
30 40 1 0
12 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.63Molecular Weight (Monoisotopic): 572.2723AlogP: 4.45#Rotatable Bonds: 9Polar Surface Area: 75.22Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.34CX LogP: 3.83CX LogD: 2.77Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.40Np Likeness Score: -1.20
References 1. Kuriwaki I, Kameda M, Iikubo K, Hisamichi H, Kawamoto Y, Kikuchi S, Moritomo H, Terasaka T, Iwai Y, Noda A, Tomiyama H, Kikuchi A, Hirano M.. (2022) Discovery of ASP5878: Synthesis and structure-activity relationships of pyrimidine derivatives as pan-FGFRs inhibitors with improved metabolic stability and suppressed hERG channel inhibitory activity., 59 [PMID:35219181 ] [10.1016/j.bmc.2022.116657 ]